CymitQuimica logo

CAS 19177-04-9

:

Benzene, 1-methyl-3-(1-methylethoxy)-

Description:
Benzene, 1-methyl-3-(1-methylethoxy)-, also known by its CAS number 19177-04-9, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a methyl group and an isopropoxy group. This compound exhibits typical properties of aromatic hydrocarbons, such as stability and a distinct, sweet odor. The presence of the isopropoxy group contributes to its solubility in organic solvents and influences its reactivity. It is generally non-polar, making it less soluble in water. The compound may participate in electrophilic substitution reactions due to the electron-donating nature of the alkyl substituents. Additionally, it may exhibit moderate volatility and can be flammable. Safety considerations include handling it in well-ventilated areas and using appropriate personal protective equipment, as it may pose health risks upon exposure. Overall, Benzene, 1-methyl-3-(1-methylethoxy)- is of interest in various chemical applications, including as an intermediate in organic synthesis.
Formula:C10H14O
InChI:InChI=1S/C10H14O/c1-8(2)11-10-6-4-5-9(3)7-10/h4-8H,1-3H3
InChI key:HZLKLSRFTPNXMY-UHFFFAOYSA-N
SMILES:CC1=CC(=CC=C1)OC(C)C
Found 4 products.