CAS 19179-12-5

HEXAHYDROPYRROLO[1,2-A]PYRAZINE-1,4-DIONE

Description:

Hexahydropyrrolo[1,2-a]pyrazine-1,4-dione, with the CAS number 19179-12-5, is a bicyclic organic compound characterized by its unique fused ring structure. This compound features a pyrrolidine and pyrazine moiety, contributing to its potential biological activity. It is typically a solid at room temperature and exhibits moderate solubility in polar solvents, which is common for compounds with multiple nitrogen atoms in their structure. The presence of the dione functional groups indicates that it can participate in various chemical reactions, such as nucleophilic additions or condensation reactions. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the ability of similar compounds to interact with biological targets. Additionally, the compound's stability and reactivity can be influenced by the substituents on the rings, making it a subject of interest for further research in organic synthesis and drug design. Overall, hexahydropyrrolo[1,2-a]pyrazine-1,4-dione represents a versatile scaffold in organic and medicinal chemistry.

Formula: C₇H₁₀N₂O₂

InChI: InChI=1/C7H10N2O2/c10-6-4-8-7(11)5-2-1-3-9(5)6/h5H,1-4H2,(H,8,11)

SMILES: C1CC2C(=NCC(=O)N2C1)O

Synonyms:

• Pyrrolo[1,2-a]pyrazine-1,4-dione, hexahydro- (6CI,7CI,8CI,9CI)
• Cyclo(Glycylprolyl)

Hexahydropyrrolo[1,2-a]pyrazine-1,4-dione

CAS: 19179-12-5

Formula: C₇H₁₀N₂O₂

Purity: 99%

Color and Shape: Solid

Molecular weight: 154.1665

Ref: IN-DA0074OG

Cyclo-(Pro-Gly)

CAS: 19179-12-5

Cyclo-(Pro-Gly) is a alkaloid with weak antibacterial activity and antioxidant properties that can inhibit Chitinase B and scavenge free radicals

Formula: C₇H₁₀N₂O₂

Purity: 99.33%

Color and Shape: Solid

Molecular weight: 154.17

Ref: TM-TN6674

Hexahydropyrrolo[1,2-a]pyrazine-1,4-dione

CAS: 19179-12-5

Hexahydropyrrolo[1,2-a]pyrazine-1,4-dione

Purity: 99%

Molecular weight: 154.17g/mol

Ref: 54-OR1042698

Vildagliptin Impurity 56

CAS: 19179-12-5

Formula: C₇H₁₀N₂O₂

Molecular weight: 154.17

Ref: 4Z-V-2275

Hexahydropyrrolo[1,2-a]pyrazine-1,4-dione

CAS: 19179-12-5

Hexahydropyrrolo[1,2-a]pyrazine-1,4-dione is a neuroprotective compound that is structurally related to the well-known anti-inflammatory drug ketoprofen. It has been shown to inhibit the production of pro-inflammatory cytokines and reactive oxygen species in vitro by a mechanism involving inhibition of mitochondrial membrane permeability. Hexahydropyrrolo[1,2-a]pyrazine-1,4-dione also inhibits bacterial growth and urea nitrogen excretion in mice. This compound has been found in cyanobacteria and some etoac extracts, as well as in bacteria from the genera Pseudomonas and Staphylococcus.

Formula: C₇H₁₀N₂O₂

Purity: Min. 95%

Molecular weight: 154.17 g/mol

Ref: 3D-UAA17912

Hexahydropyrrolo[1,2-a]pyrazine-1,4-dione

CAS: 19179-12-5

Formula: C₇H₁₀N₂O₂

Purity: 99%

Molecular weight: 154.169

Ref: 10-F329025

Vildagliptin Impurity 35

CAS: 19179-12-5

Formula: C₇H₁₀N₂O₂

Molecular weight: 154.17

Ref: ST-EA-CP-V1056