
CAS 191919-01-4
:8-Iso-15-keto PGF2α
Description:
8-Iso-15-keto PGF2α, identified by its CAS number 191919-01-4, is a synthetic derivative of prostaglandin F2α, which is a bioactive lipid involved in various physiological processes. This compound is characterized by its unique structural modifications, including the presence of an isoform at the 8-position and a keto group at the 15-position, which influence its biological activity and stability. It is known to exhibit potent effects on smooth muscle contraction and plays a role in reproductive physiology, particularly in the context of labor and menstruation. Additionally, 8-Iso-15-keto PGF2α has been studied for its potential implications in various pathological conditions, including inflammation and cardiovascular diseases. Its synthesis and characterization involve advanced organic chemistry techniques, and it is typically analyzed using methods such as chromatography and mass spectrometry to confirm its identity and purity. Overall, this compound represents a significant interest in pharmacological research due to its diverse biological effects and potential therapeutic applications.
Formula:C20H32O5
InChI:InChI=1S/C20H32O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h4,7,12-13,16-19,22-23H,2-3,5-6,8-11,14H2,1H3,(H,24,25)/b7-4-,13-12+/t16-,17+,18-,19+/m0/s1
InChI key:InChIKey=LOLJEILMPWPILA-RLXHZABYSA-N
SMILES:C(/C=C\CCCC(O)=O)[C@H]1[C@@H](/C=C/C(CCCCC)=O)[C@H](O)C[C@@H]1O
Synonyms:- 8-Iso-15-keto-prostaglandin F2α
- (5Z,8β,9α,11α,13E)-9,11-Dihydroxy-15-oxoprosta-5,13-dien-1-oic acid
- Prosta-5,13-dien-1-oic acid, 9,11-dihydroxy-15-oxo-, (5Z,8β,9α,11α,13E)-
- 8-Iso-15-keto PGF2α
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Prosta-5,13-dien-1-oic acid, 9,11-dihydroxy-15-oxo-, (5Z,8β,9α,11α,13E)-
CAS:Formula:C20H32O5Molecular weight:352.46518-iso-15-keto Prostaglandin F2α
CAS:8-iso-15-keto Prostaglandin F2α (8-iso-15-keto PGF2α) is a metabolite of the isoprostane 8-iso PGF2α in rabbits, monkeys, and humans.Formula:C20H32O5Color and Shape:SolidMolecular weight:352.471

