
CAS 191919-02-5
:(5Z,8β,9α,11α)-9,11-Dihydroxy-15-oxoprost-5-en-1-oic acid
Description:
The chemical substance known as (5Z,8β,9α,11α)-9,11-Dihydroxy-15-oxoprost-5-en-1-oic acid, with the CAS number 191919-02-5, is a derivative of prostaglandins, which are bioactive lipids involved in various physiological processes. This compound features multiple hydroxyl groups, indicating its potential for strong interactions with biological systems, particularly in receptor binding and enzyme activity modulation. The presence of a keto group contributes to its reactivity and biological activity. Its specific stereochemistry, denoted by the Z and alpha/beta designations, suggests a particular three-dimensional arrangement that is crucial for its function. Prostaglandin derivatives are often involved in inflammatory responses, regulation of blood flow, and modulation of immune responses. The unique structural characteristics of this compound may also influence its pharmacokinetics and pharmacodynamics, making it a subject of interest in medicinal chemistry and therapeutic applications. Further studies would be necessary to elucidate its specific biological activities and potential therapeutic uses.
Formula:C20H34O5
InChI:InChI=1S/C20H34O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h4,7,16-19,22-23H,2-3,5-6,8-14H2,1H3,(H,24,25)/b7-4-/t16-,17+,18-,19+/m0/s1
InChI key:InChIKey=VKTIONYPMSCHQI-JPRPWBOBSA-N
SMILES:C(/C=C\CCCC(O)=O)[C@H]1[C@@H](CCC(CCCCC)=O)[C@H](O)C[C@@H]1O
Synonyms:- Prost-5-en-1-oic acid, 9,11-dihydroxy-15-oxo-, (5Z,8β,9α,11α)-
- (5Z,8β,9α,11α)-9,11-Dihydroxy-15-oxoprost-5-en-1-oic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
8-iso-13,14-dihydro-15-keto Prostaglandin F2α
CAS:8-iso-13,14-dihydro-15-keto Prostaglandin F2α (8-iso-13,14-dihydro-15-keto PGF2α) is a metabolite of the isoprostane, 8-isoprostane (8-iso PGF2α), in rabbits,Formula:C20H34O5Color and Shape:SolidMolecular weight:354.48

