CAS 19195-43-8
:tetrazolo[1,5-b]pyridazin-6-amine
Description:
Tetrazolo[1,5-b]pyridazin-6-amine is a heterocyclic compound characterized by a fused ring system that includes both tetrazole and pyridazine moieties. This compound features a tetrazole ring, which is a five-membered ring containing four nitrogen atoms and one carbon atom, and a pyridazine ring, which is a six-membered ring containing two nitrogen atoms. The presence of an amino group (-NH2) at the 6-position of the pyridazine ring contributes to its reactivity and potential biological activity. Tetrazolo[1,5-b]pyridazin-6-amine is of interest in medicinal chemistry due to its potential applications in drug development, particularly as a scaffold for designing new pharmaceuticals. Its unique structure may impart specific pharmacological properties, making it a subject of research in various fields, including biochemistry and pharmacology. The compound is typically synthesized through multi-step organic reactions, and its properties can be influenced by substituents on the ring system, affecting solubility, stability, and biological interactions.
Formula:C4H4N6
InChI:InChI=1/C4H4N6/c5-3-1-2-4-6-8-9-10(4)7-3/h1-2H,(H2,5,7)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Tetrazolo[1,5-b]pyridazin-6-ylamine
CAS:Tetrazolo[1,5-b]pyridazin-6-ylamine is a chemical compound with the molecular formula C6H2N6. It has a mass spectrum that shows characteristic peaks at m/z 155, 121 and 107. This compound was first synthesized in 1885 and was found to have activity as an antipyretic agent. Tetrazolo[1,5-b]pyridazin-6-ylamine is used in experiments to study the effects of different substances on protein synthesis and DNA replication. The positioning of this molecule can be determined using the algorithm for molecular ion, which is based on the position of the signal in the mass spectrum.Formula:C4H4N6Purity:Min. 95%Molecular weight:136.12 g/mol
