CAS 19196-51-1
:L-Daunosamine HCl
Description:
L-Daunosamine HCl, with the CAS number 19196-51-1, is a chemical compound that serves as an important building block in the synthesis of various biologically active molecules, particularly in the field of medicinal chemistry. It is a derivative of the amino sugar daunosamine, which is commonly found in certain antibiotics, such as daunorubicin. The hydrochloride salt form indicates that it is a stable, water-soluble compound, making it suitable for various applications in pharmaceutical formulations. L-Daunosamine HCl typically exhibits characteristics such as being a white to off-white crystalline powder, with a specific melting point and solubility profile that facilitate its use in drug development. Its structure includes an amino group, which contributes to its biological activity, and it may interact with various biological targets, influencing cellular processes. As with many amino sugars, it may also play a role in glycosylation processes, impacting the pharmacokinetics and pharmacodynamics of related compounds.
Formula:C6H13NO3
InChI:InChI=1/C6H13NO3/c1-4(9)6(10)5(7)2-3-8/h3-6,9-10H,2,7H2,1H3
SMILES:CC(C(C(CC=O)N)O)O
Synonyms:- 3-Amino-4,5-dihydroxy-hexanal
- Daunosamine
- Nsc 110344
- 3-Amino-2,3,6-Trideoxyhexose
- L-Daunosamine hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
L-Daunosamine hydrochloride
CAS:<p>L-Daunosamine hydrochloride is a fluorinated sugar that is synthesized in the laboratory. It has been used for the modification of polysaccharides and other saccharides. L-Daunosamine hydrochloride is a monosaccharide that can be found in several complex carbohydrates. The CAS number for this chemical is 19196-51-1. This chemical has a high purity level, which makes it valuable for use as a synthetic material.</p>Formula:C6H14NClO3Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:183.63 g/mol

