CAS 1920-66-7
:2-Chloro-5-nitro-4-pyrimidinamine
Description:
2-Chloro-5-nitro-4-pyrimidinamine is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a chlorine atom at the 2-position and a nitro group at the 5-position contributes to its reactivity and potential applications in various chemical processes. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents. Its functional groups suggest that it may participate in nucleophilic substitution reactions and can serve as a precursor in the synthesis of pharmaceuticals or agrochemicals. The nitro group can also influence the compound's electronic properties, making it a candidate for further chemical modifications. Safety data indicates that, like many nitro compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 2-Chloro-5-nitro-4-pyrimidinamine is of interest in medicinal chemistry and materials science due to its unique structural features.
Formula:C4H3ClN4O2
InChI:InChI=1S/C4H3ClN4O2/c5-4-7-1-2(9(10)11)3(6)8-4/h1H,(H2,6,7,8)
InChI key:InChIKey=RZGOEIWDMVQJBQ-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C(N)=NC(Cl)=NC1
Synonyms:- 2-Chloro-4-amino-5-nitropyrimidine
- 2-Chloro-5-nitro-4-pyrimidinamine
- 2-Chloro-5-nitro-pyrimidin-4-ylamine
- 2-Chloro-5-nitropyrimidine-4-amine
- 4-Amino-2-Chloro-5-Nitropyrimidine
- 4-Pyrimidinamine, 2-chloro-5-nitro-
- Ai3-52033
- NSC 40838
- Pyrimidine, 4-amino-2-chloro-5-nitro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Amino-2-chloro-5-nitropyrimidine, 97%
CAS:It is an important raw material and intermediate used in organic synthesis agrochemical, pharmaceutical and dyestuff field. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand.
Formula:C4H3ClN4O2Purity:97%Color and Shape:White to yellow, PowderMolecular weight:174.544-Pyrimidinamine, 2-chloro-5-nitro-
CAS:Formula:C4H3ClN4O2Purity:95%Color and Shape:SolidMolecular weight:174.5452Ref: IN-DA002FL6
1g70.00€5g202.00€10g288.00€25g658.00€50gTo inquire100gTo inquire100mg24.00€250mg34.00€4-Amino-2-chloro-5-nitropyrimidine
CAS:4-Amino-2-chloro-5-nitropyrimidinePurity:96%Color and Shape:Pale Yellow SolidMolecular weight:174.55g/mol2-Chloro-5-nitropyrimidin-4-amine
CAS:Formula:C4H3ClN4O2Purity:95%Color and Shape:Solid, Light yellow crystalline powderMolecular weight:174.54




