CAS 1920-90-7
:Tetrabutylplumbane
Description:
Tetrabutylplumbane, with the CAS number 1920-90-7, is an organolead compound characterized by its four butyl groups attached to a central lead atom. This compound is typically a colorless to pale yellow liquid at room temperature and is known for its relatively low volatility compared to other organolead compounds. Tetrabutylplumbane is hydrophobic and insoluble in water, but it is soluble in organic solvents, which makes it useful in various chemical applications. It exhibits a high density and has a significant molecular weight due to the presence of lead. As an organometallic compound, it can act as a source of lead in organic synthesis, although its use is limited due to the toxicity associated with lead and its compounds. Safety precautions are essential when handling tetrabutylplumbane, as exposure can pose health risks. Overall, while it has specific applications in research and industry, the environmental and health implications of lead compounds necessitate careful management and regulation.
Formula:C16H36Pb
InChI:InChI=1S/4C4H9.Pb/c4*1-3-4-2;/h4*1,3-4H2,2H3;
InChI key:InChIKey=KDQHJGWPOQNCMI-UHFFFAOYSA-N
SMILES:[Pb](CCCC)(CCCC)(CCCC)CCCC
Synonyms:- Lead, tetrabutyl-
- Leadtetranbutyl
- NSC 179770
- Plumbane, tetrabutyl-
- Tetrabutyllead
- Tetrabutylplumbane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
