CAS 19200-21-6
:Phosphate(1-), hexafluoro-, nitryl (1:1)
Description:
Phosphate(1-), hexafluoro-, nitryl (1:1), with the CAS number 19200-21-6, is a chemical compound characterized by its unique combination of elements and functional groups. This substance features a phosphate group, which is a phosphorus atom bonded to four oxygen atoms, one of which carries a negative charge, indicating its anionic nature. The presence of hexafluoro indicates that the compound contains six fluorine atoms, which are highly electronegative and can significantly influence the compound's reactivity and stability. The nitryl group, consisting of a nitrogen atom double-bonded to an oxygen atom (NO2), contributes to the compound's overall chemical behavior, particularly in terms of its potential as an oxidizing agent. The combination of these groups suggests that the compound may exhibit interesting properties, such as high reactivity and potential applications in various fields, including materials science and chemical synthesis. However, specific handling and safety measures should be considered due to the presence of fluorine and nitrogen oxides, which can pose health and environmental risks.
Formula:F6P·NO2
InChI:InChI=1S/F6P.HNO2/c1-7(2,3,4,5)6;2-1-3/h;(H,2,3)/q-1;/p+1
InChI key:InChIKey=VXVFBWUABYHPFL-UHFFFAOYSA-O
SMILES:[P+5]([F-])([F-])([F-])([F-])([F-])[F-].N([O+])=O
Synonyms:- 2-(4-Chlorophenyl)-2-Oxoethyl Thiocyanate
- Nitronium hexafluorophosphate(1-)
- Nitryl hexafluorophosphate
- Nitryl hexafluorophosphate(1-)
- Phosphate(1-), hexafluoro-, nitryl
- Phosphate(1-), hexafluoro-, nitryl (1:1)
- Nitronium hexafluorophosphate
- Nitronium hexafluorophosphate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Nitronium hexafluorophosphate
CAS:Nitronium hexafluorophosphate is a nitrating reagent used in the nitration of alkanes such as methane, ethane, propane, n-butane, isobutane, neopentane and cyclohexane. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and labeFormula:F6HNO2PMolecular weight:191.98Nitronium hexafluorophosphate
CAS:Nitronium hexafluorophosphatePurity:≥95%Molecular weight:190.97g/molNitronium hexafluorophosphate, min. 97%
CAS:Nitronium hexafluorophosphate, min. 97%
Formula:NO2PF6Purity:min. 97%Color and Shape:white xtl.Molecular weight:190.97



