CAS 19205-19-7: N,N'-Dimethylquinacridone
Description:N,N'-Dimethylquinacridone is an organic compound characterized by its vibrant color and is primarily used as a pigment in various applications, including inks, coatings, and plastics. It belongs to the quinacridone family, which is known for its excellent lightfastness and stability. The compound features a complex aromatic structure, which contributes to its strong coloration properties. N,N'-Dimethylquinacridone is typically synthesized through a multi-step chemical process involving the condensation of specific precursors. It exhibits good solubility in organic solvents, making it suitable for various formulations. Additionally, this compound is recognized for its resistance to heat and chemicals, which enhances its utility in demanding environments. Safety data indicates that while it is generally considered to have low toxicity, appropriate handling and safety measures should be observed during its use and application. Overall, N,N'-Dimethylquinacridone is valued in the industry for its performance characteristics and versatility as a pigment.
Formula:C22H16N2O2
InChI:InChI=1/C22H16N2O2/c1-23-17-9-5-3-7-13(17)21(25)15-12-20-16(11-19(15)23)22(26)14-8-4-6-10-18(14)24(20)2/h3-12H,1-2H3
- Synonyms:
- 5,12-Dihydro-5,12-Dimethylquino[2,3-B]Acridine-7,14-Dione
- 5,12-Dimethylquin[2,3-B]Acridine-7,14-Dione
- Dmqa
- 5,12-Dimethyl-5,12-dihydroquino2,3-bacridine-7,14-dione
- 5,12-Dihydro-5,12-Dimethylquino[2,3-B]Acridine-7,14-Dione (Dmqa)
- N,N'-Dimethylquinacridone (refined product of D2687)
- 5,12-Dimethylquinacridone
- Lt-E503
- N,N'-Dimethyl-quinacridone

Quino[2,3-b]acridine-7,14-dione, 5,12-dihydro-5,12-dimethyl-
Ref: IN-DA002FLU
1g | 184.00 € | ||
250mg | 118.00 € |

Ref: 54-OR1014152
1g | 192.00 € | ||
100mg | 57.00 € | ||
250mg | 107.00 € |

N,N'-Dimethylquinacridone
Ref: 3B-D2687
1g | 71.00 € | ||
5g | 203.00 € |

N,N'-Dimethylquinacridone (purified by sublimation)
Ref: 3B-D3227
1g | 115.00 € |

N,N'-DimethylQuinacridone
Ref: 3D-FD40645
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information |