CAS 19207-26-2
:aggreceride A
Description:
Aggreceride A, identified by the CAS number 19207-26-2, is a chemical compound that belongs to the class of natural products known as terpenoids. It is primarily derived from certain plant sources and is characterized by its unique molecular structure, which typically includes multiple rings and functional groups that contribute to its biological activity. Aggreceride A is noted for its potential pharmacological properties, including anti-inflammatory and antimicrobial effects, making it of interest in medicinal chemistry and natural product research. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other substances. As with many natural compounds, its extraction and purification processes are crucial for studying its properties and applications. Further research is often conducted to explore its mechanisms of action and potential therapeutic uses, particularly in the fields of pharmacology and biochemistry.
Formula:C18H36O4
InChI:InChI=1/C18H36O4/c1-3-16(2)12-10-8-6-4-5-7-9-11-13-18(21)22-15-17(20)14-19/h16-17,19-20H,3-15H2,1-2H3/t16-,17+/m0/s1
Synonyms:- Tetradecanoic acid, 12-methyl-, 2,3-dihydroxypropyl ester
- 2,3-Dihydroxypropyl 12-methyltetradecanoate
- (2R)-2,3-dihydroxypropyl (12S)-12-methyltetradecanoate
- Aggreceride A
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Tetradecanoic acid,12-methyl-, (2R)-2,3-dihydroxypropyl ester, (12S)-
CAS:Formula:C18H36O4Molecular weight:316.4760Aggreceride A
CAS:Aggreceride A is an inhibitor of platelet aggregation, showing inhibitory activity towards aggregation induced by Adenosine 5'-diphosphate (ADP), Arachidonic acid, and PAF (platelet activating factor), while exhibiting lower activity against collagen-induced aggregation.Formula:C18H36O4Molecular weight:316.476
