CAS 192126-76-4
:Mycothiol
Description:
Mycothiol is a low-molecular-weight thiol compound that serves as a key antioxidant in certain bacteria, particularly in actinobacteria. It is structurally similar to glutathione but features a unique mycothiol moiety, which includes a 1,4-dithiolane ring. Mycothiol plays a crucial role in cellular redox balance, protecting cells from oxidative stress by scavenging reactive oxygen species and maintaining protein thiol groups in their reduced state. It is involved in detoxifying harmful compounds, including heavy metals and electrophiles, thereby contributing to the overall stress response of the organism. Mycothiol is synthesized from glucose-6-phosphate and cysteine, and its biosynthesis is regulated by various environmental factors. The presence of mycothiol is significant in the context of antibiotic resistance, as it can influence the susceptibility of bacteria to certain antimicrobial agents. Research into mycothiol has implications for understanding bacterial physiology and developing new therapeutic strategies against infections caused by mycobacterial pathogens.
Formula:C17H30N2O12S
InChI:InChI=1S/C17H30N2O12S/c1-4(21)18-5(3-32)16(29)19-7-9(23)8(22)6(2-20)30-17(7)31-15-13(27)11(25)10(24)12(26)14(15)28/h5-15,17,20,22-28,32H,2-3H2,1H3,(H,18,21)(H,19,29)/t5-,6+,7+,8+,9+,10-,11-,12+,13+,14+,15-,17+/m0/s1
InChI key:InChIKey=MQBCDKMPXVYCGO-FQBKTPCVSA-N
SMILES:O([C@@H]1[C@H](NC([C@@H](NC(C)=O)CS)=O)[C@@H](O)[C@H](O)[C@@H](CO)O1)[C@@H]2[C@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@H]2O
Synonyms:- 1-O-[2-[[(2R)-2-(Acetylamino)-3-mercapto-1-oxopropyl]amino]-2-deoxy-α-<span class="text-smallcaps">D</smallcap>-glucopyranosyl]-<smallcap>D</span>-myo-inositol
- <span class="text-smallcaps">D</smallcap>-myo-Inositol, 1-O-[2-[[(2R)-2-(acetylamino)-3-mercapto-1-oxopropyl]amino]-2-deoxy-α-<smallcap>D</span>-glucopyranosyl]-
- Mycothiol
- U 17
- 1-O-[2-[[(2R)-2-(Acetylamino)-3-mercapto-1-oxopropyl]amino]-2-deoxy-α-D-glucopyranosyl]-D-myo-inositol
- D-myo-Inositol, 1-O-[2-[[(2R)-2-(acetylamino)-3-mercapto-1-oxopropyl]amino]-2-deoxy-α-D-glucopyranosyl]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Mycothiol
CAS:<p>Mycothiol detoxifies, links foreign compounds, and acts as microbes' glutathione.</p>Formula:C17H30N2O12SPurity:98%Color and Shape:SolidMolecular weight:486.49Mycothiol - Stabilised with trifluoroacetic acid ammonium salt
CAS:<p>Mycothiol (MSH or AcCys-GlcN-Ins) is an unusual thiol compound found in the Actinobacteria. It is composed of a cysteine residue with an acetylated amino group linked to glucosamine, which is then linked to inositol. The oxidized, disulfide form of mycothiol (MSSM) is called mycothione, and is reduced to mycothiol by the flavoprotein mycothione reductase. Mycothiol biosynthesis and mycothiol-dependent enzymes such as mycothiol-dependent formaldehyde dehydrogenase and mycothione reductase have been proposed to be good drug targets for the development of treatments for tuberculosis.<br>This material is provided as a solid in dried buffer improve stability. MSH can readily be prepared from MSSM. Due to the rapid oxidation of MSH to MSSM, only MSSM can be shipped.</p>Formula:C34H58N4O24S2Purity:Min. 95%Color and Shape:Colorless PowderMolecular weight:970.97 g/mol

