CAS 192182-55-1
:(1-Methyl-1H-indol-5-yl)-boronic acid
Description:
(1-Methyl-1H-indol-5-yl)-boronic acid is an organic compound characterized by the presence of both an indole moiety and a boronic acid functional group. The indole structure contributes to its aromatic properties and potential biological activity, while the boronic acid group is known for its ability to form reversible covalent bonds with diols, making it useful in various chemical reactions, including Suzuki coupling reactions in organic synthesis. This compound typically appears as a solid at room temperature and is soluble in polar organic solvents. Its reactivity is influenced by the boron atom, which can participate in coordination chemistry and serve as a building block in the synthesis of more complex molecules. Additionally, the presence of the methyl group on the indole ring can affect the compound's electronic properties and steric hindrance, potentially influencing its interactions in biological systems. Overall, (1-Methyl-1H-indol-5-yl)-boronic acid is a versatile compound with applications in medicinal chemistry and materials science.
Formula:C9H10BNO2
InChI:InChI=1/C9H10BNO2/c1-11-5-4-7-6-8(10(12)13)2-3-9(7)11/h2-6,12-13H,1H3
SMILES:Cn1ccc2cc(ccc12)B(O)O
Synonyms:- N-Methylindol-5-Boronic Acid
- 1-Methylindole-5-boronic acid
- (1-Methylindol-5-Yl)Boronic Acid
- N-Methylindole-5-boronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Boronic acid, B-(1-methyl-1H-indol-5-yl)-
CAS:Formula:C9H10BNO2Purity:98%Color and Shape:SolidMolecular weight:174.99221-Methyl-1H-indole-5-boronic acid
CAS:1-Methyl-1H-indole-5-boronic acidFormula:C9H10BNO2Purity:≥95%Color and Shape: off-white powderMolecular weight:174.99g/mol1-Methyl- 5-indolylboronic acid
CAS:Formula:C9H10BNO2Purity:95%Color and Shape:SolidMolecular weight:174.99N-Methylindole-5-boronic acid
CAS:N-Methylindole-5-boronic acid is a regioselective antimicrobial agent that inhibits microbial growth. This compound has been shown to inhibit the growth of both Gram-positive and Gram-negative bacteria, as well as fungi, in vitro. N-Methylindole-5-boronic acid has been shown to be effective against strains of Escherichia coli, Bacillus subtilis, and Pseudomonas aeruginosa. The antimicrobial activity of this compound was tested using an X-ray analysis and was found to bind strongly to the bacterial cell wall in a regioselective manner.
Formula:C9H10BNO2Purity:Min. 95%Molecular weight:174.99 g/mol




