CAS 19219-98-8: 2,5,6-Trimethylbenzoxazole
Description:2,5,6-Trimethylbenzoxazole is an organic compound characterized by its heterocyclic structure, which includes a benzene ring fused to an oxazole ring. This compound features three methyl groups located at the 2, 5, and 6 positions of the benzene ring, contributing to its unique chemical properties. It is typically a pale yellow to white crystalline solid, exhibiting moderate solubility in organic solvents. The presence of the oxazole moiety imparts certain reactivity, making it useful in various chemical applications, including as a fluorescent probe or in the synthesis of other organic compounds. Its molecular structure allows for potential interactions with biological systems, which may be explored in pharmacological contexts. Additionally, 2,5,6-trimethylbenzoxazole may exhibit interesting photophysical properties, making it a candidate for studies in materials science and photochemistry. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks if ingested or inhaled.
Formula:C10H11NO
InChI:InChI=1S/C10H11NO/c1-6-4-9-10(5-7(6)2)12-8(3)11-9/h4-5H,1-3H3
InChI key:InChIKey=PDVDINPEWGXOHX-UHFFFAOYSA-N
SMILES:N=1C=2C=C(C(=CC2OC1C)C)C
- Synonyms:
- 2,5,6-Trimethylbenzoxazole
- NSC 73186
- Benzoxazole, 2,5,6-trimethyl-
- 2,5,6-Trimethyl-1,3-benzoxazole
- 2,5,6-Trimethylbenzo[d]oxazole

2,5,6-Trimethylbenzoxazole
Ref: 3B-T1845
5g | 85.00 € |

Benzoxazole, 2,5,6-trimethyl-
Ref: IN-DA002FQ2
1g | 50.00 € |

Ref: 10-F336039
1g | To inquire | ||
5g | To inquire |

2,5,6-Trimethylbenzoxazole
Ref: 3D-FT75387
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
50g | Discontinued | Request information | |
100g | Discontinued | Request information |