CAS 192203-60-4

N-[[(4-Methoxyphenyl)thio]carbonyl]-L-glutamic acid

Description:

N-[[(4-Methoxyphenyl)thio]carbonyl]-L-glutamic acid, identified by its CAS number 192203-60-4, is a synthetic compound that features a glutamic acid backbone modified with a thioester functional group. This compound is characterized by the presence of a methoxyphenyl group, which contributes to its unique chemical properties and potential biological activity. The thioester linkage enhances its reactivity, making it of interest in various chemical synthesis applications. As a derivative of L-glutamic acid, it retains the amino acid's carboxylic acid and amine functionalities, which can participate in various chemical reactions, including peptide bond formation. The methoxy group can influence the compound's solubility and polarity, affecting its interaction with biological systems. Overall, this compound may have applications in medicinal chemistry and biochemistry, particularly in the development of pharmaceuticals or as a biochemical probe, although specific biological activities would require further investigation.

Formula: C₁₃H₁₅NO₆S

InChI: InChI=1S/C13H15NO6S/c1-20-8-2-4-9(5-3-8)21-13(19)14-10(12(17)18)6-7-11(15)16/h2-5,10H,6-7H2,1H3,(H,14,19)(H,15,16)(H,17,18)/t10-/m0/s1

InChI key: InChIKey=OBCGYIKABKFIQB-JTQLQIEISA-N

SMILES: S(C(N[C@@H](CCC(O)=O)C(O)=O)=O)C1=CC=C(OC)C=C1

Synonyms:

• L-Glutamic acid, N-[[(4-methoxyphenyl)thio]carbonyl]-
• (S)-2-((((4-Methoxyphenyl)thio)carbonyl)amino)pentanedioic acid
• N-[[(4-Methoxyphenyl)thio]carbonyl]-L-glutamic acid

Carboxypeptidase G2 (CPG2) Inhibitor

CAS: 192203-60-4

Carboxypeptidase G2 (CPG2) Inhibitor

Purity: ≥98%

Molecular weight: 313.33g/mol

Ref: 54-BUP07091

Carboxypeptidase G2 (CPG2) Inhibitor

CAS: 192203-60-4

Carboxypeptidase G2 (CPG2) Inhibitor (CPG2 Inhibitor) is a new CPG2 Inhibitor with antitumor activity.

Formula: C₁₃H₁₅NO₆S

Purity: 99.96%

Color and Shape: Solid

Molecular weight: 313.33

Ref: TM-T10678