CymitQuimica logo

CAS 192214-00-9

:

(S)-1-Cbz-pyrrolidine-3-carboxylic acid

Description:
(S)-1-Cbz-pyrrolidine-3-carboxylic acid, with the CAS number 192214-00-9, is a chiral amino acid derivative characterized by its pyrrolidine ring structure. This compound features a carbobenzyloxy (Cbz) protecting group, which enhances its stability and solubility in organic solvents. The presence of the carboxylic acid functional group contributes to its acidic properties, making it useful in various chemical reactions, particularly in peptide synthesis and as a building block in medicinal chemistry. The chirality of the molecule is significant, as it can influence the biological activity and pharmacokinetics of potential drug candidates. Typically, (S)-enantiomers are preferred in pharmaceutical applications due to their often enhanced efficacy and reduced side effects compared to their (R)-counterparts. This compound is also of interest in asymmetric synthesis, where its chiral nature can be exploited to produce other chiral compounds. Overall, (S)-1-Cbz-pyrrolidine-3-carboxylic acid serves as a valuable intermediate in organic synthesis and drug development.
Formula:C13H15NO4
InChI:InChI=1/C13H15NO4/c15-12(16)11-6-7-14(8-11)13(17)18-9-10-4-2-1-3-5-10/h1-5,11H,6-9H2,(H,15,16)/t11-/m0/s1
InChI key:JSASVUTVTRNJHA-NSHDSACASA-N
SMILES:c1ccc(cc1)COC(=O)N1CC[C@@H](C1)C(=O)O
Synonyms:
  • (3S)-1-[(Benzyloxy)carbonyl]pyrrolidine-3-carboxylic acid
  • 1,3-pyrrolidinedicarboxylic acid, 1-(phenylmethyl) ester, (3S)-
  • 192214-00-9
  • (S)-1-Cbz-pyrrolidine-3-carboxylic acid
Found 4 products.