CymitQuimica logo

CAS 19225-30-0

:

6-(4-chlorophenyl)-5H-indeno[5,6-d][1,3]dioxole-5,7(6H)-dione

Description:
6-(4-Chlorophenyl)-5H-indeno[5,6-d][1,3]dioxole-5,7(6H)-dione, with the CAS number 19225-30-0, is a synthetic organic compound characterized by its complex polycyclic structure, which includes an indeno[5,6-d][1,3]dioxole core. This compound features a chlorophenyl substituent, contributing to its potential reactivity and biological activity. It typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many polycyclic compounds. The presence of the dioxole and diketone functional groups suggests potential for hydrogen bonding and reactivity in various chemical environments. This compound may be of interest in medicinal chemistry due to its structural features, which could influence its pharmacological properties. Additionally, its unique structure may allow for interactions with biological targets, making it a candidate for further research in drug development or material science. However, specific applications and biological activities would require empirical studies to elucidate its behavior in various contexts.
Formula:C16H9ClO4
InChI:InChI=1/C16H9ClO4/c17-9-3-1-8(2-4-9)14-15(18)10-5-12-13(21-7-20-12)6-11(10)16(14)19/h1-6,14H,7H2
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.