CAS 19226-99-4

2,5-bis[4-(dimethylamino)benzylidene]cyclopentanone

Description:

2,5-bis[4-(dimethylamino)benzylidene]cyclopentanone, identified by its CAS number 19226-99-4, is an organic compound characterized by its complex structure, which includes a cyclopentanone core substituted with two 4-(dimethylamino)benzylidene groups. This compound typically exhibits properties such as a high degree of solubility in organic solvents, making it useful in various applications, including organic synthesis and potentially in dye chemistry due to its chromophoric nature. The presence of dimethylamino groups contributes to its electron-donating characteristics, which can influence its reactivity and interaction with light, making it a candidate for photochemical studies. Additionally, the compound may display interesting optical properties, such as fluorescence, depending on the specific conditions and environment. Its structural features suggest potential applications in materials science, particularly in the development of organic light-emitting diodes (OLEDs) or as a dye in various industrial applications. However, safety and handling precautions should be observed due to the presence of amine groups, which can be hazardous.

Formula: C₂₃H₂₆N₂O

InChI: InChI=1/C23H26N2O/c1-24(2)21-11-5-17(6-12-21)15-19-9-10-20(23(19)26)16-18-7-13-22(14-8-18)25(3)4/h5-8,11-16H,9-10H2,1-4H3

SMILES: CN(C)c1ccc(cc1)C=C1CCC(=Cc2ccc(cc2)N(C)C)C1=O

2,5-Bis(4-dimethylaminobenzylidene)cyclopentanone

CAS: 19226-99-4

2,5-Bis(4-dimethylaminobenzylidene)cyclopentanone

Purity: 95%

Ref: 54-OR1043591

2,5-Bis(4-dimethylaminobenzylidene)cyclopentanone

CAS: 19226-99-4

Color and Shape: Solid

Molecular weight: 346.4739990234375

Ref: 10-F342285