CAS 19228-10-5
:2-methyl-3-[(2E,6E,10E,14E,18E,22E,26E,30E,34E,38E)-3,7,11,15,19,23,27,31,35,39,43-undecamethyltetratetraconta-2,6,10,14,18,22,26,30,34,38,42-undecaen-1-yl]naphthalene-1,4-dione
Description:
The chemical substance known as 2-methyl-3-[(2E,6E,10E,14E,18E,22E,26E,30E,34E,38E)-3,7,11,15,19,23,27,31,35,39,43-undecamethyltetratetraconta-2,6,10,14,18,22,26,30,34,38,42-undecaen-1-yl]naphthalene-1,4-dione, with the CAS number 19228-10-5, is a complex organic compound characterized by its large molecular structure and multiple double bonds. This compound features a naphthalene backbone, which is a polycyclic aromatic hydrocarbon, and is substituted with a long-chain aliphatic hydrocarbon moiety. The presence of multiple conjugated double bonds contributes to its potential for unique optical and electronic properties. Additionally, the methyl and naphthoquinone functional groups may impart specific reactivity and biological activity. Such compounds are often studied for their applications in materials science, organic electronics, and potentially in biological systems due to their structural complexity and functional versatility. The intricate arrangement of carbon chains and functional groups suggests potential uses in various fields, including organic synthesis and nanotechnology.
Formula:C66H96O2
InChI:InChI=1/C66H96O2/c1-50(2)26-16-27-51(3)28-17-29-52(4)30-18-31-53(5)32-19-33-54(6)34-20-35-55(7)36-21-37-56(8)38-22-39-57(9)40-23-41-58(10)42-24-43-59(11)44-25-45-60(12)48-49-62-61(13)65(67)63-46-14-15-47-64(63)66(62)68/h14-15,26,28,30,32,34,36,38,40,42,44,46-48H,16-25,27,29,31,33,35,37,39,41,43,45,49H2,1-13H3/b51-28+,52-30+,53-32+,54-34+,55-36+,56-38+,57-40+,58-42+,59-44+,60-48+
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

