CAS 19230-50-3

2-Iodo-5-nitrobenzoic acid

Description:

2-Iodo-5-nitrobenzoic acid is an organic compound characterized by the presence of both an iodine atom and a nitro group attached to a benzoic acid structure. Its molecular formula is C7H4I NO4, indicating that it contains seven carbon atoms, four hydrogen atoms, one iodine atom, one nitrogen atom, and four oxygen atoms. This compound typically appears as a yellow crystalline solid and is known for its moderate solubility in organic solvents and limited solubility in water. The presence of the nitro group contributes to its acidic properties, while the iodine substituent can influence its reactivity and potential applications in organic synthesis. 2-Iodo-5-nitrobenzoic acid is often utilized in various chemical reactions, including nucleophilic substitutions and as a building block in the synthesis of more complex molecules. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. Proper handling and storage are essential due to its chemical properties and potential hazards.

Formula: C₇H₄INO₄

InChI: InChI=1/C7H4INO4/c8-6-2-1-4(9(12)13)3-5(6)7(10)11/h1-3H,(H,10,11)

InChI key: InChIKey=JSSFIFUXHORXJX-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC(N(=O)=O)=CC=C1I

Synonyms:

• Benzoic Acid, 2-Iodo-5-Nitro-
• 2-Iodo-5-nitrobenzoic acid

2-Iodo-5-nitrobenzoic acid

CAS: 19230-50-3

Formula: C₇H₄INO₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 293.016

Ref: 10-F212982

Benzoic acid, 2-​iodo-​5-​nitro-

CAS: 19230-50-3

Formula: C₇H₄INO₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 293.0154

Ref: IN-DA002FTJ

2-Iodo-5-nitrobenzoic acid

CAS: 19230-50-3

2-Iodo-5-nitrobenzoic acid

Purity: 98%

Molecular weight: 293.02g/mol

Ref: 54-OR74324

2-Iodo-5-nitrobenzoic acid

CAS: 19230-50-3

2-Iodo-5-nitrobenzoic acid is a reactive molecule that reacts with terminal alkynes to form a fluorescent compound. It was immobilized on an electrode and used as a probe in voltammetry studies. 2-Iodo-5-nitrobenzoic acid is also used as a reagent in the synthesis of amides, which are important in many biochemical reactions. The use of this compound may be limited by the toxicity to cells, which can be increased through the presence of cisplatin or 3-aminobenzoic acid. The microenvironment around cancer cells may also alter the reactivity of 2-iodo-5-nitrobenzoic acid.

Formula: C₇H₄INO₄

Purity: Min. 95%

Color and Shape: Beige Powder

Molecular weight: 293.02 g/mol

Ref: 3D-FI70917