CAS 1923051-63-1

1-Oxa-6-azaspiro[3.5]nonane, ethanedioate (1:1)

Description:

1-Oxa-6-azaspiro[3.5]nonane, ethanedioate (1:1) is a chemical compound characterized by its unique spirocyclic structure, which incorporates both nitrogen and oxygen heteroatoms. The presence of the oxo and azaspiro groups contributes to its potential biological activity and reactivity. This compound typically exhibits a moderate level of solubility in polar solvents due to the presence of the ethanedioate moiety, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as spiro compounds often exhibit interesting pharmacological properties. The compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Additionally, the specific arrangement of atoms within the spiro framework may lead to unique stereochemical properties, which can be critical in drug design and synthesis. Overall, 1-Oxa-6-azaspiro[3.5]nonane, ethanedioate (1:1) represents a fascinating area of study within organic and medicinal chemistry.

Formula: C₇H₁₃NO·C₂H₂O₄

InChI: InChI=1S/C7H13NO.C2H2O4/c1-2-7(3-5-9-7)6-8-4-1;3-1(4)2(5)6/h8H,1-6H2;(H,3,4)(H,5,6)

InChI key: InChIKey=XKQNWXLVAHYLBZ-UHFFFAOYSA-N

SMILES: C12(CCO1)CCCNC2.C(C(O)=O)(O)=O

Synonyms:

• 1-Oxa-6-azaspiro[3.5]nonane, ethanedioate (1:1)

1-Oxa-6-azaspiro[3.5]nonane oxalate

CAS: 1923051-63-1

1-Oxa-6-azaspiro[3.5]nonane oxalate

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 217.22g/mol

Ref: 54-OR16709