CAS 19231-60-8

(4,5,6,7-tetraiodo-1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)acetic acid

Description:

(4,5,6,7-tetraiodo-1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)acetic acid, with CAS number 19231-60-8, is a complex organic compound characterized by its unique structure that includes multiple iodine substituents and a dioxo group. The presence of four iodine atoms significantly influences its physical and chemical properties, such as increased molecular weight and potential for enhanced reactivity. This compound is likely to exhibit strong electron-withdrawing characteristics due to the iodine atoms, which can affect its acidity and reactivity in various chemical reactions. The dioxo functionality suggests potential for chelation and coordination with metal ions, making it of interest in coordination chemistry. Additionally, the isoindole framework may impart specific biological activities, which could be explored in medicinal chemistry. Its solubility, stability, and reactivity would depend on the solvent and conditions used, making it a subject of interest for further research in organic synthesis and potential applications in pharmaceuticals or materials science.

Formula: C₁₀H₃I₄NO₄

InChI: InChI=1/C10H3I4NO4/c11-5-3-4(6(12)8(14)7(5)13)10(19)15(9(3)18)1-2(16)17/h1H2,(H,16,17)

SMILES: C(C(=O)O)N1C(=O)c2c(c(c(c(c2I)I)I)I)C1=O

2-(4,5,6,7-Tetraiodo-1,3-dioxoisoindolin-2-yl)acetic acid

CAS: 19231-60-8

This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci

Formula: C₁₀H₃I₄NO₄

Molecular weight: 708.75

Ref: 02-J64414

TID43

CAS: 19231-60-8

TID43, a CK2 inhibitor, exhibits potent inhibition with an IC50 value of 0.3 μM. It is applicable in anti-angiogenic research [1].

Formula: C₁₀H₃I₄NO₄

Color and Shape: Solid

Molecular weight: 708.755

Ref: TM-T84508