CymitQuimica logo

CAS 192316-25-9

:

1-[[3,4-Bis(phenylmethoxy)phenyl]methyl]-6-nitro-1H-benzimidazole

Description:
1-[[3,4-Bis(phenylmethoxy)phenyl]methyl]-6-nitro-1H-benzimidazole is a synthetic organic compound characterized by its complex structure, which includes a benzimidazole core substituted with a nitro group and a phenylmethoxy moiety. The presence of the nitro group typically imparts certain electronic properties, potentially enhancing the compound's reactivity and solubility in organic solvents. The bis(phenylmethoxy) substitution suggests that the compound may exhibit significant steric hindrance, which can influence its biological activity and interaction with other molecules. This compound may be of interest in medicinal chemistry due to its potential pharmacological properties, as benzimidazole derivatives are often explored for their roles in various therapeutic applications, including anti-cancer and anti-inflammatory activities. Additionally, the presence of multiple aromatic rings may contribute to its stability and lipophilicity, affecting its bioavailability and distribution in biological systems. Overall, this compound represents a unique structure that could be valuable in research and development within the field of organic and medicinal chemistry.
Formula:C28H23N3O4
InChI:InChI=1S/C28H23N3O4/c32-31(33)24-12-13-25-26(16-24)30(20-29-25)17-23-11-14-27(34-18-21-7-3-1-4-8-21)28(15-23)35-19-22-9-5-2-6-10-22/h1-16,20H,17-19H2
InChI key:InChIKey=KBQNKCWQQQONKT-UHFFFAOYSA-N
SMILES:C(N1C=2C(N=C1)=CC=C(N(=O)=O)C2)C3=CC(OCC4=CC=CC=C4)=C(OCC5=CC=CC=C5)C=C3
Synonyms:
  • 1H-Benzimidazole, 1-[[3,4-bis(phenylmethoxy)phenyl]methyl]-6-nitro-
  • 1-[[3,4-Bis(phenylmethoxy)phenyl]methyl]-6-nitro-1H-benzimidazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.