CAS 192322-50-2

N-[[4-[[(4-aminoquinazolin-2-yl)amino]methyl]cyclohexyl]methyl]naphthalene-1-sulfonamide hydrochloride

Description:

N-[[4-[[(4-aminoquinazolin-2-yl)amino]methyl]cyclohexyl]methyl]naphthalene-1-sulfonamide hydrochloride is a chemical compound characterized by its complex structure, which includes a naphthalene sulfonamide moiety linked to a cyclohexyl group and a quinazoline derivative. This compound typically exhibits properties associated with sulfonamides, such as antibacterial activity, although its specific biological activity may vary based on its structural components. The presence of the amino and sulfonamide functional groups suggests potential interactions with biological targets, making it of interest in medicinal chemistry. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, which can enhance its bioavailability. The compound's molecular weight, solubility, and stability can be influenced by environmental factors such as pH and temperature. Overall, this substance may be explored for therapeutic applications, particularly in the fields of oncology or infectious diseases, due to its structural features that suggest potential pharmacological activity.

Formula: C₂₆H₃₀ClN₅O₂S

InChI: InChI=1/C26H29N5O2S.ClH/c27-25-22-9-3-4-10-23(22)30-26(31-25)28-16-18-12-14-19(15-13-18)17-29-34(32,33)24-11-5-7-20-6-1-2-8-21(20)24;/h1-11,18-19,29H,12-17H2,(H3,27,28,30,31);1H/t18-,19-;

InChI key: InChIKey=DIQDKUNCSVFGHH-VPLSKCCHNA-N

SMILES: c1ccc2c(c1)cccc2S(=O)(=O)NC[C@H]1CC[C@@H](CC1)CN=c1[nH]c2ccccc2c(=N)[nH]1.Cl

CGP71683 HCl

CAS: 192322-50-2

Formula: C₂₆H₃₀ClN₅O₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 512.0667

Ref: IN-DA002FTZ

CGP71683 hydrochloride

CAS: 192322-50-2

CGP71683 hydrochloride

Purity: ≥98%

Molecular weight: 512.07g/mol

Ref: 54-BUP04850

CGP71683 hydrochloride

CAS: 192322-50-2

CGP71683 hydrochloride: NPY5 receptor antagonist, Ki=1.3 nM; inactive at Y1 (Ki >4000 nM) and Y2 (Ki=200 nM).

Formula: C₂₆H₃₀ClN₅O₂S

Purity: 99.92%

Color and Shape: Solid

Molecular weight: 512.07

Ref: TM-T5587

CGP 71683 hydrochloride

CAS: 192322-50-2

Non-peptide NPY Y5 receptor antagonist

Formula: C₂₆H₃₀ClN₅O₂S

Purity: Min. 95%

Molecular weight: 512.07 g/mol

Ref: 3D-FC160953