CAS 192323-44-7
:2-chloro-6-fluoroquinazolin-4-amine
Description:
2-Chloro-6-fluoroquinazolin-4-amine is a chemical compound belonging to the quinazoline family, characterized by a bicyclic structure that includes a fused benzene and pyrimidine ring. This compound features a chlorine atom at the second position and a fluorine atom at the sixth position of the quinazoline ring, along with an amino group at the fourth position. These substituents contribute to its unique chemical properties and potential biological activity. The presence of halogens (chlorine and fluorine) often enhances lipophilicity and can influence the compound's reactivity and interaction with biological targets. 2-Chloro-6-fluoroquinazolin-4-amine may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting various diseases. Its molecular structure allows for potential interactions with enzymes or receptors, which could be explored in drug design. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C8H5ClFN3
InChI:InChI=1/C8H5ClFN3/c9-8-12-6-2-1-4(10)3-5(6)7(11)13-8/h1-3H,(H2,11,12,13)
SMILES:c1cc2c(cc1F)c(=N)[nH]c(Cl)n2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
