CAS 192441-08-0
:Lomeguatrib
Description:
Lomeguatrib, with the CAS number 192441-08-0, is a chemical compound that has garnered attention primarily for its application in the field of medicinal chemistry, particularly as a potential therapeutic agent. It is characterized by its unique molecular structure, which includes specific functional groups that contribute to its biological activity. Lomeguatrib acts as a selective inhibitor of certain enzymes, which can play a crucial role in various biochemical pathways. This selectivity is significant for its potential use in treating conditions such as cancer, where modulation of enzyme activity can influence tumor growth and progression. The compound's pharmacokinetic properties, including absorption, distribution, metabolism, and excretion, are essential for determining its efficacy and safety profile in clinical settings. Additionally, ongoing research is focused on understanding its mechanism of action and optimizing its therapeutic potential. As with many experimental compounds, further studies are necessary to fully elucidate its characteristics and applications in medicine.
Formula:C10H8BrN5OS
InChI:InChI=1S/C10H8BrN5OS/c11-5-1-6(18-3-5)2-17-9-7-8(14-4-13-7)15-10(12)16-9/h1,3-4H,2H2,(H3,12,13,14,15,16)
InChI key:InChIKey=JUJPKFNFCWJBCX-UHFFFAOYSA-N
SMILES:O(CC1=CC(Br)=CS1)C2=C3C(=NC(N)=N2)N=CN3
Synonyms:- 1H-Purin-2-amine, 6-[(4-bromo-2-thienyl)methoxy]-
- 2-Amino-6-(4-bromothiophen-2-ylmethoxy)-9H-purine
- 2-Amino-6-[(4-bromo-2-thienyl)methoxy]-9H-purine
- 6-[(4-Bromo-2-thienyl)methoxy]-9H-purin-2-amine
- 6-[(4-bromothiophen-2-yl)methoxy]-7H-purin-2-amine
- 9H-Purin-2-amine, 6-[(4-bromo-2-thienyl)methoxy]-
- PaTrin 2
- Lomeguatrib
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
9H-Purin-2-amine, 6-[(4-bromo-2-thienyl)methoxy]-
CAS:Formula:C10H8BrN5OSPurity:98%Color and Shape:SolidMolecular weight:326.1724Lomeguatrib
CAS:Lomeguatrib (PaTrin-2), a modified guanine base, inhibits the activity of DNA repair protein O(6)-alkylguanine-DNA alkyltransferase (MGMT) .Formula:C10H8BrN5OSPurity:99.26% - >99.99%Color and Shape:SolidMolecular weight:326.17Lomeguatrib
CAS:Inhibitor and pseudosubstrate of DNA repair protein O6-methylguanine-DNA methyltransferase (MGMT). It is used as a sensitizer for the treatment of advanced solid tumors, including prostate, colorectal and central nervous system malignancies. Lomeguatrib inhibits the repair mechanism of DNA damage induced by alkylating agents such as temozolomide, and therefore potentiates its anti-cancer effects.Formula:C10H8BrN5OSPurity:Min. 95%Color and Shape:SolidMolecular weight:326.17 g/mol



