
CAS 192461-95-3
:11,12-Dihydroxyeicosatrienoic acid
Description:
11,12-Dihydroxyeicosatrienoic acid (DHTA) is a bioactive lipid derived from arachidonic acid, characterized by the presence of two hydroxyl groups at the 11th and 12th carbon positions of its eicosatrienoic acid backbone. This compound is part of the eicosanoid family, which plays crucial roles in various physiological processes, including inflammation, vascular function, and cell signaling. DHTA is known to exhibit potent biological activities, influencing processes such as platelet aggregation and vascular smooth muscle contraction. Its synthesis occurs through the action of specific enzymes, including lipoxygenases, which convert arachidonic acid into various hydroxylated metabolites. The compound's structure contributes to its reactivity and interaction with biological membranes, impacting its function in cellular signaling pathways. Research into DHTA has highlighted its potential therapeutic implications, particularly in cardiovascular health and inflammatory conditions. As a relatively less-studied eicosanoid, ongoing investigations aim to elucidate its precise mechanisms of action and potential applications in medicine.
Formula:C20H34O4
InChI:InChI=1/C20H34O4/c1-2-3-4-5-9-12-15-18(21)19(22)16-13-10-7-6-8-11-14-17-20(23)24/h6,8-10,12-13,18-19,21-22H,2-5,7,11,14-17H2,1H3,(H,23,24)/b8-6-,12-9-,13-10-
InChI key:InChIKey=LRPPQRCHCPFBPE-KROJNAHFNA-N
SMILES:C(C(C/C=C\CCCCC)O)(C/C=C\C/C=C\CCCC(O)=O)O
Synonyms:- 5,8,14-Eicosatrienoic acid, 11,12-dihydroxy-, (5Z,8Z,14Z)-
- 5,8,14-Eicosatrienoic acid, 11,12-dihydroxy-, (all-Z)-
- 11,12-DHET
- 11,12-Dihydroxyeicosatrienoic acid
- (5Z,8Z,14Z)-11,12-Dihydroxy-5,8,14-eicosatrienoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
5,8,14-Eicosatrienoic acid, 11,12-dihydroxy-, (5Z,8Z,14Z)-
CAS:Formula:C20H34O4Molecular weight:338.481611,12-DiHETrE
CAS:11,12-DiHETrE: Endogenous P450 eicosanoid, used in preterm labor study and NAFL/NASH differentiation.Formula:C20H34O4Color and Shape:SolidMolecular weight:338.48

