CAS 19250-02-3

1-biphenyl-2-ylthiourea

Description:

1-Biphenyl-2-ylthiourea, with the CAS number 19250-02-3, is an organic compound characterized by the presence of a thiourea functional group attached to a biphenyl moiety. This compound typically exhibits a white to off-white crystalline appearance and is known for its moderate solubility in organic solvents. It is often utilized in various chemical applications, including as a reagent in organic synthesis and as a potential intermediate in the production of pharmaceuticals and agrochemicals. The presence of the thiourea group imparts unique chemical reactivity, allowing for participation in nucleophilic substitution reactions and the formation of metal complexes. Additionally, 1-biphenyl-2-ylthiourea may exhibit biological activity, making it of interest in medicinal chemistry. Safety data indicates that, like many thiourea derivatives, it should be handled with care due to potential toxicity and environmental impact. Proper safety measures, including the use of personal protective equipment, are recommended when working with this compound in laboratory settings.

Formula: C₁₃H₁₂N₂S

InChI: InChI=1/C13H12N2S/c14-13(16)15-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9H,(H3,14,15,16)

SMILES: c1ccc(cc1)c1ccccc1NC(=N)S

Synonyms:

• thiourea, N-[1,1'-biphenyl]-2-yl-

{N}-biphenyl-2-ylthiourea

CAS: 19250-02-3

Formula: C₁₃H₁₂N₂S

Purity: 90%

Molecular weight: 228.3128

Ref: IN-DA00JDA8

1-([1,1'-Biphenyl]-2-yl)thiourea

CAS: 19250-02-3

1-([1,1'-Biphenyl]-2-yl)thiourea

Purity: 90%

Molecular weight: 228.32g/mol

Ref: 54-OR1066481

AI3-15089

CAS: 19250-02-3

AI3-15089 is used as an Experimental Pesticide.

Formula: C₁₃H₁₂N₂S

Color and Shape: Solid

Molecular weight: 228.31

Ref: TM-T25008