CAS 19254-69-4
:Ergosta-4,6,8(14),22-tetraen-3-one
Description:
Ergosta-4,6,8(14),22-tetraen-3-one, with the CAS number 19254-69-4, is a steroidal compound that belongs to the ergosterol family, which is primarily found in fungi and some plants. This compound is characterized by its polyunsaturated structure, featuring multiple double bonds within its carbon backbone, which contributes to its biological activity. Ergosta-4,6,8(14),22-tetraen-3-one is known for its role as a precursor in the biosynthesis of various sterols and has been studied for its potential pharmacological properties, including antifungal and anti-inflammatory effects. Its unique structure allows it to interact with biological membranes, influencing membrane fluidity and permeability. Additionally, this compound may exhibit antioxidant properties, making it of interest in the field of medicinal chemistry. Overall, ergosta-4,6,8(14),22-tetraen-3-one is a significant compound in both natural product chemistry and pharmacology, with ongoing research exploring its various applications and mechanisms of action.
Formula:C28H40O
InChI:InChI=1S/C28H40O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h7-10,17-20,24,26H,11-16H2,1-6H3/b8-7+/t19-,20+,24+,26-,27-,28+/m0/s1
InChI key:InChIKey=OIMXTYUHMBQQJM-HSVWHVBGSA-N
SMILES:C[C@@]12C(=C3[C@@]([C@]4(C)C(C=C3)=CC(=O)CC4)(CC1)[H])CC[C@@]2([C@@H](/C=C/[C@@H](C(C)C)C)C)[H]
Synonyms:- (22E)-4,6,8(14),22-Ergostatetraen-3-one
- (22E,24R)-Ergosta-4,6,8(14),22-tetraen-3-one
- Ergone
- Ergosta-4,6,8(14),22-tetraen-3-one
- ergosta-4,6,8(14),22-tetraen-3-one, (22E)-
- (22E)-Ergosta-4,6,8(14),22-tetraen-3-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Ergosta-4,6,8(14),22-tetraen-3-one, (22E)-
CAS:Formula:C28H40OPurity:98%Color and Shape:SolidMolecular weight:392.6166Ergosta-4,6,8(14),22-tetraen-3-one
CAS:Ergosta-4,6,8(14),22-tetraen-3-one is a natural ergosterol derivative suitable for biochemical experiments and drug synthesis research.Formula:C28H40OPurity:98%Color and Shape:SolidMolecular weight:392.62Ergosta-4,6,8(14),22-tetraen-3-one
CAS:Formula:C28H40OPurity:95%~99%Color and Shape:Cryst.Molecular weight:392.627(22E)-Ergosta-4,6,8(14),22-tetraen-3-one
CAS:Formula:C28H40OColor and Shape:Light Yellow SolidMolecular weight:392.62Ergosta-4,6,8(14),22-tetraen-3-one
CAS:Controlled ProductErgosta-4,6,8(14),22-tetraen-3-one is a fatty acid that occurs naturally in the acetate extract of the kidney of sheep. It has been shown to induce apoptosis in cervical cancer cells and inhibit growth of bacteria by inhibiting energy metabolism. Ergosta-4,6,8(14),22-tetraen-3-one can be used as an antimicrobial agent because it has broad-spectrum activity against bacteria and fungi. This compound also has been found to be effective in treating kidney fibrosis. It has been shown to inhibit tubulointerstitial injury and plasma concentration–time curve by binding to human serum albumin.
Formula:C28H40OPurity:Min. 95%Molecular weight:392.62 g/mol





