CAS 19261-06-4
:dibenzo[b,d]furan-4-ol
Description:
Dibenzo[b,d]furan-4-ol is an organic compound characterized by its fused bicyclic structure, which consists of two benzene rings and a furan ring, with a hydroxyl (-OH) group attached at the 4-position of the furan. This compound is typically a white to light yellow solid at room temperature and is known for its aromatic properties, contributing to its stability and potential reactivity. Dibenzo[b,d]furan-4-ol exhibits moderate solubility in organic solvents, while its solubility in water is limited due to its hydrophobic nature. The presence of the hydroxyl group allows for hydrogen bonding, which can influence its chemical behavior and interactions. This compound may be of interest in various fields, including organic synthesis and materials science, due to its unique structural features and potential applications in the development of pharmaceuticals or as a building block in organic chemistry. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C12H8O2
InChI:InChI=1/C12H8O2/c13-10-6-3-5-9-8-4-1-2-7-11(8)14-12(9)10/h1-7,13H
SMILES:c1ccc2c(c1)c1cccc(c1o2)O
Synonyms:- 4-Dibenzofuranol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Dibenzo[b,d]furan-4-ol
CAS:Dibenzo[b,d]furan-4-olFormula:C12H8O2Purity:≥95%Color and Shape: pale peach. fluffy crystalline powderMolecular weight:184.19g/molDibenzo[b,d]furan-4-ol
CAS:Dibenzo[b,d]furan-4-ol is a biodegradable compound that can be synthesized in a stepwise manner. The compound can be assayed by using different methods including mass spectrometric and hplc analyses to determine the number of carbon atoms and functional groups present in the molecule. Dibenzo[b,d]furan-4-ol is used as a carbon source for many microorganisms. The compound has been shown to hydroxylate under aerobic conditions and also reacts with nitro groups to form nitroso derivatives. Magnetic resonance spectroscopy has been used to study the molecular structure of dibenzo[b,d]furan-4-ol, which has revealed that it is monosubstituted with two methyl groups. This compound is naturally found in filamentous fungi found in tropical regions.
Formula:C12H8O2Purity:Min. 95%Molecular weight:184.19 g/molRef: 3D-UAA26106
Discontinued product



