CAS 19263-11-7

2-(2-methylbenzyl)butanedioic acid

Description:

2-(2-Methylbenzyl)butanedioic acid, also known by its CAS number 19263-11-7, is an organic compound characterized by its dicarboxylic acid structure. It features a butanedioic acid backbone, which is substituted with a 2-methylbenzyl group at one end. This substitution imparts unique physical and chemical properties to the compound, including increased hydrophobicity due to the aromatic ring. The presence of two carboxylic acid functional groups allows for potential hydrogen bonding and reactivity, making it useful in various chemical reactions and applications. The compound is likely to be a solid at room temperature, with moderate solubility in polar solvents. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Additionally, the compound may exhibit specific biological activities, although detailed studies would be necessary to elucidate its full range of properties and potential uses. As with many organic compounds, safety data should be consulted to ensure proper handling and usage.

Formula: C₁₂H₁₄O₄

InChI: InChI=1/C12H14O4/c1-8-4-2-3-5-9(8)6-10(12(15)16)7-11(13)14/h2-5,10H,6-7H2,1H3,(H,13,14)(H,15,16)

SMILES: Cc1ccccc1CC(CC(=O)O)C(=O)O

Synonyms:

• Butanedioic Acid, 2-[(2-Methylphenyl)Methyl]-

2-(2-Methylbenzyl)succinic acid

CAS: 19263-11-7

2-(2-Methylbenzyl)succinic acid

Purity: 95%

Molecular weight: 222.24g/mol

Ref: 54-OR1049431

2-[(2-methylphenyl)methyl]butanedioic acid

CAS: 19263-11-7

Purity: 95%

Molecular weight: 222.2400055

Ref: 10-F653543

2-Methylbenzylsuccinic Acid

Controlled Product

CAS: 19263-11-7

Formula: C₁₂H₁₄O₄

Color and Shape: Neat

Molecular weight: 222.237

Ref: TR-M880000

2-[(2-Methylphenyl)methyl]butanedioic acid

CAS: 19263-11-7

2-[(2-Methylphenyl)methyl]butanedioic acid is a nitrate that is produced by the conversion of 2-methylbenzylsuccinic acid. It can be used as an electron acceptor in microbial assays and has been shown to have the ability to mineralize carbon sources such as xylene. It has also been shown to be capable of transforming benzoate, benzylsuccinic acid, and other substrates, but it does not form benzaldehyde or other metabolic products. The enzyme responsible for its conversion is a dehydrogenase.

Formula: C₁₂H₁₄O₄

Purity: Min. 95%

Molecular weight: 222.24 g/mol

Ref: 3D-UAA26311