CAS 192642-85-6

2-(5-bromo-2-pyridyl)acetic acid

Description:

2-(5-Bromo-2-pyridyl)acetic acid is an organic compound characterized by its pyridine ring substituted with a bromine atom and an acetic acid functional group. The presence of the bromine atom at the 5-position of the pyridine ring enhances its reactivity and can influence its biological activity. This compound typically appears as a solid at room temperature and is soluble in polar solvents due to the carboxylic acid group, which can engage in hydrogen bonding. Its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry and drug development. The compound may exhibit various properties such as acidity, which is influenced by the carboxylic acid group, and it may participate in various chemical reactions, including esterification and amidation. Additionally, the bromine substituent can affect the compound's electronic properties and steric hindrance, which can be crucial for its reactivity and interactions in biological systems. Overall, 2-(5-bromo-2-pyridyl)acetic acid is a versatile compound with potential applications in pharmaceuticals and agrochemicals.

Formula: C₇H₆BrNO₂

InChI: InChI=1/C7H6BrNO2/c8-5-1-2-6(9-4-5)3-7(10)11/h1-2,4H,3H2,(H,10,11)

SMILES: c1cc(CC(=O)O)ncc1Br

Synonyms:

• (5-Bromopyridin-2-yl)acetic acid
• 2-(5-Bromopyridin-2-yl)acetic acid
• 2-Pyridineacetic Acid, 5-Bromo-

5-Bromo-2-pyridineacetic acid, 98%

CAS: 192642-85-6

This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci

Formula: C₇H₆BrNO₂

Purity: 98%

Color and Shape: Pale cream, Powder

Molecular weight: 216.03

Ref: 02-H33181

(5-Bromopyridin-2-yl)acetic acid

CAS: 192642-85-6

Formula: C₇H₆BrNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 216.0320

Ref: IN-DA002G6C

(5-Bromopyridin-2-yl)acetic acid

CAS: 192642-85-6

(5-Bromopyridin-2-yl)acetic acid

Purity: 99%

Molecular weight: 216.03g/mol

Ref: 54-OR70028

2-(5-Bromopyridin-2-yl)acetic acid

CAS: 192642-85-6

Formula: C₇H₆BrNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 216.034

Ref: 10-F075811