CAS 192642-96-9
:2-(3-bromo-2-pyridyl)acetic acid hydrochloride
Description:
2-(3-Bromo-2-pyridyl)acetic acid hydrochloride is a chemical compound characterized by its pyridine ring structure, which is substituted with a bromine atom and an acetic acid functional group. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it useful in various chemical applications. The presence of the bromine atom enhances its reactivity, allowing it to participate in nucleophilic substitution reactions. The hydrochloride form indicates that the compound is a salt, which can influence its stability and solubility properties. This substance may be utilized in pharmaceutical research and development, particularly in the synthesis of biologically active molecules. Additionally, its unique structural features may contribute to its potential as a ligand in coordination chemistry or as a building block in organic synthesis. As with any chemical, proper handling and safety precautions should be observed due to its potential biological activity and reactivity.
Formula:C7H7BrClNO2
InChI:InChI=1/C7H6BrNO2.ClH/c8-5-2-1-3-9-6(5)4-7(10)11;/h1-3H,4H2,(H,10,11);1H
SMILES:c1cc(c(CC(=O)O)nc1)Br.Cl
Synonyms:- (3-Bromopyridin-2-yl)acetic acid hydrochloride (1:1)
- 2-(3-Bromopyridin-2-Yl)Acetic Acid Hydrochloride
- 2-Pyridineacetic Acid, 3-Bromo-, Hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
