CAS 19269-28-4
:3-Methylhexanal
Description:
3-Methylhexanal is an organic compound classified as an aldehyde, characterized by its six-carbon chain with a methyl group attached to the third carbon. Its molecular formula is C7H14O, indicating the presence of a carbonyl group (C=O) typical of aldehydes. This compound is a colorless liquid at room temperature and possesses a distinctive, pleasant odor, often described as fruity or nutty, which makes it of interest in the flavor and fragrance industries. 3-Methylhexanal is soluble in organic solvents and has limited solubility in water due to its hydrophobic hydrocarbon chain. It can participate in various chemical reactions, including oxidation to form corresponding carboxylic acids and reduction to yield alcohols. Additionally, it can undergo reactions typical of aldehydes, such as nucleophilic addition. Due to its structural features, 3-Methylhexanal can also serve as a building block in organic synthesis, contributing to the development of more complex molecules in chemical research and industrial applications.
Formula:C7H14O
InChI:InChI=1/C7H14O/c1-3-4-7(2)5-6-8/h6-7H,3-5H2,1-2H3
InChI key:InChIKey=ZSJUABCTGCNBPF-UHFFFAOYSA-N
SMILES:C(CCC)(CC=O)C
Synonyms:- Hexanal, 3-methyl-
- 3-Methylhexanal
- (±)-3-Methylhexanal
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
