CAS 19271-90-0

(2-TERT-BUTYLPHENOXY)ACETIC ACID

Description:

(2-Tert-butylphenoxy)acetic acid, with the CAS number 19271-90-0, is an organic compound characterized by its phenoxy and acetic acid functional groups. It features a tert-butyl group attached to a phenolic ring, which enhances its lipophilicity and stability. This compound is typically a white to off-white solid at room temperature and is soluble in organic solvents, while its solubility in water is limited due to its hydrophobic characteristics. It is known for its applications in various fields, including as a herbicide and in agricultural formulations, where it acts as a plant growth regulator. The presence of the acetic acid moiety contributes to its reactivity and potential interactions with biological systems. Additionally, the compound's structure allows for specific interactions with target enzymes or receptors, making it of interest in biochemical research. Safety data indicates that, like many organic compounds, it should be handled with care, following appropriate safety protocols to minimize exposure and environmental impact.

Formula: C₁₂H₁₅O₃

InChI: InChI=1/C12H16O3/c1-12(2,3)9-6-4-5-7-10(9)15-8-11(13)14/h4-7H,8H2,1-3H3,(H,13,14)/p-1

SMILES: CC(C)(C)c1ccccc1OCC(=O)[O-]

Synonyms:

• (2-Tert-Butylphenoxy)Acetate

Acetic acid, 2-[2-(1,1-dimethylethyl)phenoxy]-

CAS: 19271-90-0

Formula: C₁₂H₁₆O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 208.2536

Ref: IN-DA002G9B

2-(2-(tert-Butyl)phenoxy)acetic acid

CAS: 19271-90-0

2-(2-(tert-Butyl)phenoxy)acetic acid

Purity: 98%

Ref: 54-OR1037661

(2-tert-Butyl-phenoxy)-acetic acid

CAS: 19271-90-0

Formula: C₁₂H₁₆O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 208.257

Ref: 10-F057016

(2-tert-Butyl-phenoxy)-acetic acid

CAS: 19271-90-0

2-tert-Butyl-phenoxyacetic acid is a chain compound that has a crystal structure with hydrogen bonds. This compound has a disordered conformation and is composed of two dimers connected by hydrogen bonds. The dimers are linked by a benzene ring and form hydrogen-bonded chains. The molecule also has an asymmetric dihedral conformation. 2-tert-Butylphenoxyacetic acid can exist as either of the two conformations, depending on the environment it is in.
2-tert-Butylphenoxyacetic acid is soluble in alcohols, ethers, acetone, and chloroform. It has been shown to inhibit the growth of bacteria when used as a preservative agent in food products.

Formula: C₁₂H₁₆O₃

Purity: Min. 95%

Molecular weight: 208.25 g/mol

Ref: 3D-UAA27190