CAS 192717-19-4

3-(1H-indol-5-yl)propanoic acid

Description:

3-(1H-indol-5-yl)propanoic acid, also known as indolepropanoic acid, is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a propanoic acid side chain attached to the indole at the 3-position. It is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols. The presence of both the indole and carboxylic acid functional groups contributes to its potential biological activity, including roles in various biochemical pathways. Indole derivatives are known for their significance in pharmaceuticals and natural products, often exhibiting properties such as anti-inflammatory and antioxidant activities. The compound's molecular structure allows for interactions with biological targets, making it of interest in medicinal chemistry and research. As with many organic acids, it may exhibit acidic behavior in solution, influencing its reactivity and interactions with other chemical species.

Formula: C₁₁H₁₁NO₂

InChI: InChI=1/C11H11NO2/c13-11(14)4-2-8-1-3-10-9(7-8)5-6-12-10/h1,3,5-7,12H,2,4H2,(H,13,14)

SMILES: c1cc2c(cc[nH]2)cc1CCC(=O)O

Synonyms:

• 1H-indole-5-propanoic acid

1H-Indole-5-propanoic acid

CAS: 192717-19-4

Formula: C₁₁H₁₁NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 189.2105

Ref: IN-DA002G8W

3-(1H-Indol-5-yl)propanoic acid

CAS: 192717-19-4

3-(1H-Indol-5-yl)propanoic acid

Purity: 97%

Molecular weight: 189.21g/mol

Ref: 54-OR1034650

3-(1H-Indol-5-yl)propanoic acid

CAS: 192717-19-4

Purity: 97%

Molecular weight: 189.2140045

Ref: 10-F626469

3-(1H-indol-5-yl)propanoic acid

Controlled Product

CAS: 192717-19-4

Applications 3-(1H-indol-5-yl)propanoic acid (cas# 192717-19-4) is a useful research chemical.

Formula: C₁₁H₁₁NO₂

Color and Shape: Neat

Molecular weight: 189.21

Ref: TR-I628288