CymitQuimica logo

CAS 192725-45-4

:

(2S,3S,5S)-2-(2,6-Dimethylphenoxyacetyl)amino-3-hydroxy-5-(tert-butoxycarbonyl)amino-1,6-diphenylhexane

Description:
The chemical substance with the name "(2S,3S,5S)-2-(2,6-Dimethylphenoxyacetyl)amino-3-hydroxy-5-(tert-butoxycarbonyl)amino-1,6-diphenylhexane" and CAS number "192725-45-4" is a complex organic compound characterized by its specific stereochemistry and functional groups. It features a hexane backbone with multiple chiral centers, which contributes to its stereoisomerism. The presence of an amino group and a hydroxy group indicates potential for hydrogen bonding, influencing its solubility and reactivity. The tert-butoxycarbonyl (Boc) group serves as a protecting group for the amino functionality, commonly used in peptide synthesis. The dimethylphenoxyacetyl moiety suggests that the compound may exhibit specific biological activity, potentially interacting with biological targets due to its structural complexity. Overall, this compound's unique arrangement of functional groups and stereochemistry may confer specific pharmacological properties, making it of interest in medicinal chemistry and drug development. Further studies would be necessary to elucidate its biological activity and potential applications.
Formula:C33H42N2O5
InChI:InChI=1S/C33H42N2O5/c1-23-13-12-14-24(2)31(23)39-22-30(37)35-28(20-26-17-10-7-11-18-26)29(36)21-27(19-25-15-8-6-9-16-25)34-32(38)40-33(3,4)5/h6-18,27-29,36H,19-22H2,1-5H3,(H,34,38)(H,35,37)/t27-,28-,29-/m0/s1
InChI key:QYYDVAZZRBOAFD-AWCRTANDSA-N
SMILES:CC1=C(C(=CC=C1)C)OCC(=O)N[C@@H](CC2=CC=CC=C2)[C@H](C[C@H](CC3=CC=CC=C3)NC(=O)OC(C)(C)C)O
Found 3 products.