CAS 192725-50-1: (αS)-Tetrahydro-α-(1-methylethyl)-2-oxo-1(2H)-pyrimidineacetic acid
Description:(αS)-Tetrahydro-α-(1-methylethyl)-2-oxo-1(2H)-pyrimidineacetic acid, with CAS number 192725-50-1, is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered heterocyclic compound containing two nitrogen atoms. This substance features a tetrahydro configuration, indicating that it has undergone partial hydrogenation, resulting in a saturated ring structure. The presence of a ketone group (2-oxo) and a carboxylic acid group (acetic acid) contributes to its reactivity and potential biological activity. The specific stereochemistry denoted by (αS) suggests a particular spatial arrangement of atoms, which can influence the compound's interactions in biological systems. This compound may exhibit properties relevant to medicinal chemistry, potentially serving as a precursor or intermediate in the synthesis of pharmaceuticals. Its solubility, stability, and reactivity would depend on the functional groups present and the overall molecular structure, making it a subject of interest in both synthetic and medicinal chemistry research.
Formula:C9H16N2O3
InChI:InChI=1S/C9H16N2O3/c1-6(2)7(8(12)13)11-5-3-4-10-9(11)14/h6-7H,3-5H2,1-2H3,(H,10,14)(H,12,13)/t7-/m0/s1
InChI key:InChIKey=AFGBRTKUTJQHIP-ZETCQYMHSA-N
SMILES:O=C1NCCCN1C(C(=O)O)C(C)C
- Synonyms:
- (2S)-3-Methyl-2-(2-oxo-1,3-diazinan-1-yl)butanoic acid
- (S)-3-methyl-2-(2-oxotetrahydropyrimidin-1(2H)-yl)butanoic acid
- (αS)-Tetrahydro-α-(1-methylethyl)-2-oxo-1(2H)-pyrimidineacetic acid
- 1(2H)-Pyrimidineacetic acid, tetrahydro-α-(1-methylethyl)-2-oxo-, (S)-
- 1(2H)-Pyrimidineacetic acid, tetrahydro-α-(1-methylethyl)-2-oxo-, (αS)-
- 3-methyl-2-(2-oxotetrahydropyrimidin-1(2H)-yl)butanoic acid
- TPA
