CAS 19275-44-6
:1-Isomangostin
Description:
1-Isomangostin, with the CAS number 19275-44-6, is a natural compound belonging to the class of xanthones, which are polyphenolic compounds primarily found in the mangosteen fruit (Garcinia mangostana). This compound is characterized by its complex structure, featuring a chromone-like backbone with multiple hydroxyl groups that contribute to its biological activity. 1-Isomangostin exhibits various pharmacological properties, including antioxidant, anti-inflammatory, and potential anticancer effects, making it of interest in medicinal chemistry and nutraceutical research. Its solubility is generally low in water but can be enhanced in organic solvents, which is typical for many xanthones. The compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Additionally, 1-Isomangostin's interaction with biological systems is an area of ongoing research, particularly regarding its mechanisms of action and therapeutic potential. Overall, this compound represents a significant focus in the study of natural products and their applications in health and disease management.
Formula:C24H26O6
InChI:InChI=1S/C24H26O6/c1-12(2)6-7-14-19-17(11-16(26)22(14)28-5)29-18-10-15(25)13-8-9-24(3,4)30-23(13)20(18)21(19)27/h6,10-11,25-26H,7-9H2,1-5H3
InChI key:InChIKey=JUHXHWKPHWGZKL-UHFFFAOYSA-N
SMILES:O=C1C=2C3=C(C(O)=CC2OC=4C1=C(CC=C(C)C)C(OC)=C(O)C4)CCC(C)(C)O3
Synonyms:- 2H,12H-Pyrano[2,3-a]xanthen-12-one, 3,4-dihydro-5,9-dihydroxy-10-methoxy-2,2-dimethyl-11-(3-methyl-2-buten-1-yl)-
- 2H,12H-Pyrano[2,3-a]xanthen-12-one, 3,4-dihydro-5,9-dihydroxy-10-methoxy-2,2-dimethyl-11-(3-methyl-2-butenyl)-
- 3,4-Dihydro-5,9-dihydroxy-10-methoxy-2,2-dimethyl-11-(3-methyl-2-buten-1-yl)-2H,12H-pyrano[2,3-a]xanthen-12-one
- 5,9-dihydroxy-10-methoxy-2,2-dimethyl-11-(3-methylbut-2-en-1-yl)-3,4-dihydro-2H,12H-pyrano[2,3-a]xanthen-12-one
- 1-Isomangostin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Isomangostin
CAS:1-Isomangostin has cytotoxic and anticomplementary activities.
Formula:C24H26O6Purity:99.45%Color and Shape:SolidMolecular weight:410.461-IsOmangOstin
CAS:1-IsOmangOstin is a monoclonal antibody that binds to the complement system, inhibiting its activation. The structure of 1-IsOmangOstin has been shown to inhibit the activity of enzymes involved in inflammation and cancer. 1-IsOmangOstin has also been shown to inhibit the activity of enzymes involved in the synthesis of proinflammatory cytokines and prostaglandins, which are important mediators in inflammatory conditions such as arthritis. It was found that 1-IsOmangOstin inhibits tumor growth by binding with high affinity to a receptor on tumor cells, leading to inhibition of DNA synthesis and cell division.Purity:Min. 95%



