
CAS 19275-51-5
:Cyclomulberrin
Description:
Cyclomulberrin, with the CAS number 19275-51-5, is a chemical compound that belongs to the class of natural products known as terpenes. It is characterized by its complex cyclic structure, which contributes to its unique chemical properties and biological activities. Cyclomulberrin is primarily derived from certain plant sources and is often studied for its potential applications in pharmaceuticals and agriculture due to its antimicrobial and antifungal properties. The compound exhibits a distinctive odor, which can vary depending on its concentration and the presence of other substances. Its solubility characteristics typically indicate that it is more soluble in organic solvents than in water, making it suitable for various extraction and formulation processes. Additionally, cyclomulberrin's stability under different environmental conditions is an important factor in its usability in various applications. As with many natural compounds, further research is ongoing to fully understand its mechanisms of action and potential therapeutic benefits.
Formula:C25H24O6
InChI:InChI=1S/C25H24O6/c1-12(2)5-7-15-17(27)11-18(28)21-23(29)22-20(9-13(3)4)30-19-10-14(26)6-8-16(19)25(22)31-24(15)21/h5-6,8-11,20,26-28H,7H2,1-4H3
InChI key:InChIKey=SYFDWXWLRGHYAJ-UHFFFAOYSA-N
SMILES:C(=C(C)C)C1C2=C(C=3C(O1)=CC(O)=CC3)OC=4C(C2=O)=C(O)C=C(O)C4CC=C(C)C
Synonyms:- Stereoisomer of 3,8,10-trihydroxy-11-(3-methyl-2-buten-1-yl)-6-(2-methyl-1-propen-1-yl)-6H,7H-[1]benzopyrano[4,3-b][1]benzopyran-7-one
- 6H,7H-[1]Benzopyrano[4,3-b][1]benzopyran-7-one, 3,8,10-trihydroxy-9-(3-methyl-2-butenyl)-6-(2-methylpropenyl)-
- 6H,7H-[1]Benzopyrano[4,3-b][1]benzopyran-7-one, 3,8,10-trihydroxy-11-(3-methyl-2-buten-1-yl)-6-(2-methyl-1-propen-1-yl)-, stereoisomer
- 6H,7H-[1]Benzopyrano[4,3-b][1]benzopyran-7-one, 3,8,10-trihydroxy-11-(3-methyl-2-butenyl)-6-(2-methyl-1-propenyl)-
- Cyclomulberrin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Cyclomulberrin
CAS:<p>Cyclomulberrin is a useful organic compound for research related to life sciences and the catalog number is T125471.</p>Formula:C25H24O6Color and Shape:SolidMolecular weight:420.461Cyclomulberrin
CAS:<p>Cyclomulberrin is a phytochemical compound, which is derived from the natural extracts of the Morus (mulberry) genus. This compound is a cyclic derivative, formed through the modification of mulberrofuran, a naturally occurring compound in mulberries. Its mode of action involves the modulation of specific biological pathways, primarily through its antioxidant and anti-inflammatory properties. Cyclomulberrin has the capacity to scavenge free radicals and inhibit pro-inflammatory cytokine production, thereby reducing oxidative stress and inflammation at the cellular level.</p>Formula:C25H24O6Purity:Min. 95%Molecular weight:420.50 g/mol

