CAS 1928-89-8

6-(pyrrolidin-1-yl)-5H-purine

Description:

6-(Pyrrolidin-1-yl)-5H-purine, also known by its CAS number 1928-89-8, is a purine derivative characterized by the presence of a pyrrolidine ring attached to the 6-position of the purine structure. This compound exhibits properties typical of purines, including potential biological activity, as purines are fundamental components of nucleic acids and play crucial roles in cellular processes. The pyrrolidine moiety may influence its solubility, stability, and interaction with biological targets, making it of interest in medicinal chemistry and pharmacology. The compound's structure suggests it may participate in hydrogen bonding and other interactions due to the presence of nitrogen atoms in both the purine and pyrrolidine rings. Its potential applications could span from serving as a building block in drug design to acting as a ligand in biochemical assays. However, specific details regarding its reactivity, pharmacokinetics, and biological effects would require further investigation through experimental studies.

Formula: C₉H₁₁N₅

InChI: InChI=1/C9H11N5/c1-2-4-14(3-1)9-7-8(11-5-10-7)12-6-13-9/h5-7H,1-4H2

SMILES: C1CCN(C1)C1=NC=NC2=NC=NC12

6-(Pyrrolidin-1-yl)-9H-purine

CAS: 1928-89-8

6-(Pyrrolidin-1-yl)-9H-purine is an inhibitor of lipid peroxidation. It has been shown to scavenge free radicals and prevent the formation of reactive oxygen species (ROS) by inhibiting the lipoxygenase enzyme. This compound also inhibits superoxide, a ROS that is produced in large quantities during irradiation, and thrombin activity. 6-(Pyrrolidin-1-yl)-9H-purine has a stable anion that interacts with other compounds and can be used as an antithrombotic agent.

Formula: C₉H₁₁N₅

Purity: Min. 95%

Molecular weight: 189.22 g/mol

Ref: 3D-BAA92889