CAS 192821-39-9

(2S,3S)-2-Amino-N,N,3-trimethylpentanamide

Description:

(2S,3S)-2-Amino-N,N,3-trimethylpentanamide, with CAS number 192821-39-9, is an organic compound characterized by its amide functional group and a chiral center, which contributes to its stereochemistry. This compound features a pentanamide backbone with two stereogenic centers, specifically at the 2 and 3 positions, indicating that it exists in specific enantiomeric forms. The presence of three methyl groups attached to the nitrogen atom enhances its steric bulk and can influence its solubility and reactivity. Typically, amides like this compound exhibit moderate polarity due to the carbonyl group, which can engage in hydrogen bonding, affecting their physical properties such as boiling and melting points. The amino group also contributes to its basicity, making it potentially reactive in various chemical reactions, including those involving nucleophiles. This compound may find applications in pharmaceuticals or as a building block in organic synthesis, although specific applications would depend on its biological activity and interaction with other chemical entities.

Formula: C₈H₁₈N₂O

InChI: InChI=1S/C8H18N2O/c1-5-6(2)7(9)8(11)10(3)4/h6-7H,5,9H2,1-4H3/t6-,7-/m0/s1

InChI key: InChIKey=BBURRWZXFUJMSZ-BQBZGAKWSA-N

SMILES: [C@@H](C(N(C)C)=O)([C@H](CC)C)N

Synonyms:

• Pentanamide, 2-amino-N,N,3-trimethyl-, [S-(R*,R*)]-
• Pentanamide, 2-amino-N,N,3-trimethyl-, (2S,3S)-
• (2S,3S)-2-Amino-N,N,3-trimethylpentanamide

(2S,3S)-2-Amino-N,N,3-trimethylpentanamide

CAS: 192821-39-9

Versatile small molecule scaffold

Formula: C₈H₁₈N₂O

Purity: Min. 95%

Molecular weight: 158.24 g/mol

Ref: 3D-SHA82139