CAS 19285-83-7
:DL-Glutamic acid monohydrate
Description:
DL-Glutamic acid monohydrate is a crystalline amino acid that serves as a building block for proteins and plays a crucial role in various metabolic processes. It is a racemic mixture of the D- and L- forms of glutamic acid, an important neurotransmitter in the central nervous system. The substance is typically white to off-white in appearance and is soluble in water, making it useful in various biochemical applications. Its molecular formula includes carbon, hydrogen, nitrogen, and oxygen, reflecting its classification as an amino acid. DL-Glutamic acid monohydrate is often utilized in the food industry as a flavor enhancer and in the pharmaceutical sector for its potential therapeutic properties. Additionally, it is involved in the synthesis of other amino acids and serves as a precursor for neurotransmitters. The monohydrate form indicates the presence of one molecule of water associated with each molecule of glutamic acid, which can influence its stability and solubility characteristics. Overall, DL-Glutamic acid monohydrate is a versatile compound with significant biological and industrial relevance.
Formula:C5H11NO5
InChI:InChI=1/C5H9NO4.H2O/c6-3(5(9)10)1-2-4(7)8;/h3H,1-2,6H2,(H,7,8)(H,9,10);1H2
SMILES:C(CC(=O)O)C(C(=O)O)N.O
Synonyms:- DL-2-Aminoglutaric acid monohydrate
- H-DL-Glu-OH.H_2O
- Glutamic Acid Hydrate (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
DL-Glutamic acid monohydrate, 98+%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C5H11NO5Purity:98+%Color and Shape:White, Crystalline powder or powderMolecular weight:165.15DL-Glutamic Acid Monohydrate
CAS:Formula:C5H11NO5Purity:97%Color and Shape:SolidMolecular weight:165.1445DL-Glutamic acid monohydrate
CAS:Formula:C5H9NO4·H2OPurity:98.0 - 101.0 % (dried basis)Color and Shape:White powderMolecular weight:165.15DL-Glutamic acid monohydrate
CAS:<p>DL-Glutamic acid monohydrate</p>Purity:99%Molecular weight:165.14g/molDL-Glutamic acid monohydrate
CAS:DL-Glutamic acid monohydrate is a DL mixture of glutamic acid, widely used in biochemical experiments and drug synthesis research.Formula:C5H11NO5Purity:99.81%Color and Shape:SolidMolecular weight:165.15DL-Glutamic acid monohydrate
CAS:Formula:C5H11NO5Purity:97%Color and Shape:Liquid, No data available.Molecular weight:165.145Dl-glutamic acid monohydrate
CAS:Controlled Product<p>Applications Dl-glutamic acid monohydrate<br></p>Formula:C5H11NO5Color and Shape:NeatMolecular weight:165.15
