CAS 192869-80-0

4-Chloro-5,6,7,8-tetrahydro-7-(phenylmethyl)pyrido[3,4-d]pyrimidine

Description:

4-Chloro-5,6,7,8-tetrahydro-7-(phenylmethyl)pyrido[3,4-d]pyrimidine is a heterocyclic compound characterized by its complex bicyclic structure, which incorporates both pyridine and pyrimidine moieties. The presence of a chloro substituent at the 4-position and a phenylmethyl group at the 7-position contributes to its unique chemical properties and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry for the development of pharmaceuticals. The compound may also display various functional properties, such as fluorescence or reactivity with nucleophiles, due to the presence of the chloro group and the nitrogen atoms in the ring system. As with many heterocycles, its reactivity and stability can be influenced by environmental factors such as pH and temperature. Overall, 4-Chloro-5,6,7,8-tetrahydro-7-(phenylmethyl)pyrido[3,4-d]pyrimidine represents a class of compounds with diverse applications in chemical research and drug development.

Formula: C₁₄H₁₄ClN₃

InChI: InChI=1S/C14H14ClN3/c15-14-12-6-7-18(9-13(12)16-10-17-14)8-11-4-2-1-3-5-11/h1-5,10H,6-9H2

InChI key: InChIKey=ZUDXEFPMOWJJQK-UHFFFAOYSA-N

SMILES: ClC1=C2C(CN(CC3=CC=CC=C3)CC2)=NC=N1

Synonyms:

• 4-Chloro-5,6,7,8-tetrahydro-7-(phenylmethyl)pyrido[3,4-d]pyrimidine
• Pyrido[3,4-D]Pyrimidine, 4-Chloro-5,6,7,8-Tetrahydro-7-(Phenylmethyl)-
• 7-Benzyl-4-chloro-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine

Pyrido[3,4-d]pyrimidine, 4-chloro-5,6,7,8-tetrahydro-7-(phenylmethyl)-

CAS: 192869-80-0

Formula: C₁₄H₁₄ClN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 259.7341

Ref: IN-DA002GFD

7-Benzyl-4-chloro-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine

CAS: 192869-80-0

7-Benzyl-4-chloro-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine

Purity: 96%

Molecular weight: 259.73g/mol

Ref: 54-OR1001898

7-Benzyl-4-chloro-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine

CAS: 192869-80-0

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 259.739990234375

Ref: 10-F093241

7-Benzyl-4-chloro-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine

CAS: 192869-80-0

7-Benzyl-4-chloro-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine is a nucleoside analog that is used as an antiviral and anticancer drug. It has also been shown to have antimalarial activity. 7-Benzyl-4-chloro-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine inhibits the replication of HIV by blocking the viral reverse transcriptase enzyme. This drug is a phosphoramidite monophosphate with a purity of 99%.

Formula: C₁₄H₁₄ClN₃

Purity: Min. 95%

Molecular weight: 259.73 g/mol

Ref: 3D-NB57451