CAS 19293-58-4
:4-DIMETHYLAMINOBENZYLAMINE
Description:
4-Dimethylaminobenzylamine is an organic compound characterized by its amine functional group and a dimethylamino substituent on a benzylamine structure. It typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. This compound is known for its role as an intermediate in the synthesis of various pharmaceuticals and agrochemicals, owing to its ability to participate in nucleophilic reactions. It exhibits basic properties due to the presence of the amine group, allowing it to form salts with acids. Additionally, 4-Dimethylaminobenzylamine may have applications in dye manufacturing and as a catalyst in certain chemical reactions. Safety considerations are important, as it may be harmful if ingested or inhaled, and appropriate handling procedures should be followed to minimize exposure. Overall, its chemical reactivity and structural features make it a valuable compound in organic synthesis and industrial applications.
Formula:C6H10Cl2
InChI:InChI=1/C6H10Cl2/c7-5-1-2-6(8)4-3-5/h5-6H,1-4H2
SMILES:C1CC(CCC1Cl)Cl
Synonyms:- Akos Bbs-00002736
- Rarechem Al Bw 0167
- 1,4-Dichlorocyclohexane
- 4-(Dimethylamino)-benzylamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Dimethylaminobenzylamine
CAS:Formula:C9H14N2Purity:97%Color and Shape:LiquidMolecular weight:150.22094-(Aminomethyl)-N,N-dimethylaniline
CAS:<p>4-(Aminomethyl)-N,N-dimethylaniline</p>Formula:C9H14N2Purity:97%Color and Shape: clear. faint yellow liquidMolecular weight:150.22085g/mol(4,N-Dimethylamino)benzylamine
CAS:<p>4,N-Dimethylamino)benzylamine is a chromatographic standard that is used to measure the activity of human serum enzymes. It is also used as a reagent in analytical chemistry for the preparation of fatty acids with nmr spectra. This product can be used to detect amines by chemiluminescent reaction and can also be used as an intermediate in carnitine synthesis.</p>Formula:C9H14N2Purity:Min. 95%Molecular weight:150.22 g/mol
