CAS 19307-13-2

7-HYDROXY-1-NAPHTHONITRILE

Description:

7-Hydroxy-1-naphthonitrile, with the CAS number 19307-13-2, is an organic compound characterized by the presence of both a hydroxyl group (-OH) and a nitrile group (-C≡N) attached to a naphthalene ring system. This compound typically appears as a solid and is known for its aromatic properties due to the naphthalene structure, which contributes to its stability and potential reactivity. The hydroxyl group can participate in hydrogen bonding, influencing its solubility in polar solvents, while the nitrile group can engage in various chemical reactions, including nucleophilic additions. 7-Hydroxy-1-naphthonitrile may be utilized in organic synthesis and as an intermediate in the production of dyes, pharmaceuticals, or agrochemicals. Its specific physical and chemical properties, such as melting point, boiling point, and solubility, can vary based on purity and environmental conditions. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₁₁H₇NO

InChI: InChI=1/C11H7NO/c12-7-9-3-1-2-8-4-5-10(13)6-11(8)9/h1-6,13H

SMILES: c1cc2ccc(cc2c(c1)C#N)O

Synonyms:

• 7-Hydroxynaphthalene-1-carbonitrile

7-HYDROXY-1-NAPHTHONITRILE

CAS: 19307-13-2

Formula: C₁₁H₇NO

Purity: 98%

Color and Shape: Solid

Molecular weight: 169.1794

Ref: IN-DA00ACDA

7-Hydroxynaphthalene-1-carbonitrile

CAS: 19307-13-2

7-Hydroxynaphthalene-1-carbonitrile

Purity: 95%

Molecular weight: 169.18g/mol

Ref: 54-OR2133

7-Hydroxynaphthalene-1-carbonitrile

CAS: 19307-13-2

Purity: 98%

Molecular weight: 169.1829987

Ref: 10-F692241

7-Hydroxynaphthalene-1-carbonitrile

Controlled Product

CAS: 19307-13-2

Formula: C₁₁H₇NO

Color and Shape: Neat

Molecular weight: 169.179

Ref: TR-H951158