CAS 19310-98-6

8-Methyl-1-naphthalenecarboxylic acid

Description:

8-Methyl-1-naphthalenecarboxylic acid is an aromatic carboxylic acid characterized by its naphthalene structure, which consists of two fused benzene rings. The presence of a methyl group at the 8-position and a carboxylic acid functional group at the 1-position contributes to its unique chemical properties. This compound typically appears as a solid at room temperature and is soluble in organic solvents, while exhibiting limited solubility in water due to its hydrophobic naphthalene backbone. It has potential applications in organic synthesis and as an intermediate in the production of various chemical compounds. The presence of the carboxylic acid group allows for participation in acid-base reactions, while the aromatic system can engage in electrophilic substitution reactions. Additionally, 8-Methyl-1-naphthalenecarboxylic acid may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₂H₁₀O₂

InChI: InChI=1S/C12H10O2/c1-8-4-2-5-9-6-3-7-10(11(8)9)12(13)14/h2-7H,1H3,(H,13,14)

InChI key: InChIKey=FLBHUCKQJRXXQB-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C2=C(C=CC=C2C)C=CC1

Synonyms:

• 8-Methyl-1-naphthalenecarboxylic acid
• 1-Naphthoic acid, 8-methyl-
• 1-Naphthalenecarboxylic acid, 8-methyl-
• 8-Methyl-1-naphthoic acid
• 1-Methyl-8-naphthoic acid

8-methylnaphthalene-1-carboxylic acid

CAS: 19310-98-6

Formula: C₁₂H₁₀O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 186.2066

Ref: IN-DA00AKJE

8-Methyl-1-naphthoic acid

CAS: 19310-98-6

8-Methyl-1-naphthoic acid

Purity: 97%

Molecular weight: 186.21g/mol

Ref: 54-OR81647

8-METHYL-1-NAPHTHOIC ACID

CAS: 19310-98-6

Formula: C₁₂H₁₀O₂

Purity: 97%

Molecular weight: 186.21

Ref: 10-F470533

8-Methylnaphthalene-1-carboxylic acid

CAS: 19310-98-6

8-Methylnaphthalene-1-carboxylic acid is an intermediate in the synthesis of acenaphthylene. It is a lactone that can be obtained by irradiation of methanol and acetone with ultraviolet light. 8-Methylnaphthalene-1-carboxylic acid is a dione that can be synthesized from naphthalene and formaldehyde. The chemical reaction involves the formation of a carbene, which reacts with an oxygen molecule to produce a carboxyl group. This intermediate can then undergo pyrolysis to produce acenaphthylene.

Formula: C₁₂H₁₀O₂

Purity: Min. 95%

Molecular weight: 186.21 g/mol

Ref: 3D-UAA31098