CAS 193149-77-8

1,3-Benzenedisulfonic acid, 4-[[2-(4-nitrophenyl)hydrazinylidene]methyl]-, sodium salt (1:2)

Description:

1,3-Benzenedisulfonic acid, 4-[[2-(4-nitrophenyl)hydrazinylidene]methyl]-, sodium salt (1:2) is a chemical compound characterized by its sulfonic acid functional groups and a hydrazone linkage. This compound typically appears as a solid, often in crystalline form, and is soluble in water due to the presence of sodium ions, which enhance its ionic character. The presence of the nitrophenyl group contributes to its potential as a chromophore, making it useful in various applications, including dye chemistry and as a reagent in organic synthesis. The sulfonic acid groups impart strong acidity, which can influence its reactivity and interactions in chemical processes. Additionally, the hydrazone structure may exhibit tautomerism and can participate in various chemical reactions, including condensation and coupling reactions. Overall, this compound's unique structural features make it valuable in both industrial and research settings, particularly in the development of dyes and pharmaceuticals.

Formula: C₁₃H₁₁N₃O₈S₂·2Na

InChI: InChI=1S/C13H11N3O8S2.2Na/c17-16(18)11-4-2-10(3-5-11)15-14-8-9-1-6-12(25(19,20)21)7-13(9)26(22,23)24;;/h1-8,15H,(H,19,20,21)(H,22,23,24);;

InChI key: InChIKey=STXYSQPPXUOVMY-UHFFFAOYSA-N

SMILES: C(=NNC1=CC=C(N(=O)=O)C=C1)C2=C(S(=O)(=O)O)C=C(S(=O)(=O)O)C=C2.[Na]

Synonyms:

• 1,3-Benzenedisulfonic acid, 4-[[(4-nitrophenyl)hydrazono]methyl]-, disodium salt
• 1,3-Benzenedisulfonic acid, 4-[[2-(4-nitrophenyl)hydrazinylidene]methyl]-, sodium salt (1:2)

2,4-Disulfobenzaldehyde-4'-nitrophenylhydrazine Disodium Salt

Controlled Product

CAS: 193149-77-8

Formula: C₁₃H₉N₃O₈S₂·2Na

Color and Shape: Neat

Molecular weight: 445.34

Ref: TR-D493680