CAS 193153-60-5

4-Pyridinemethanamine,N-cyclopropyl-(9CI)

Description:

4-Pyridinemethanamine, N-cyclopropyl- (CAS 193153-60-5) is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a cyclopropyl group attached to the nitrogen of the amine, contributing to its unique properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amine functional group. The compound is of interest in medicinal chemistry and may possess biological activity, making it relevant for pharmaceutical research. Its structure allows for potential interactions with biological targets, which can be explored for therapeutic applications. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices. Overall, 4-Pyridinemethanamine, N-cyclopropyl- represents a class of compounds that can be synthesized and studied for various chemical and biological properties.

Formula: C₉H₁₂N₂

InChI: InChI=1/C9H12N2/c1-2-9(1)11-7-8-3-5-10-6-4-8/h3-6,9,11H,1-2,7H2

SMILES: C1CC1NCc1ccncc1

Synonyms:

• 4-pyridinemethanamine, N-cyclopropyl-
• N-(pyridin-4-ylmethyl)cyclopropanamine

N-(Pyridin-4-ylmethyl)cyclopropanamine

CAS: 193153-60-5

Formula: C₉H₁₂N₂

Molecular weight: 148.2050

Ref: IN-DA00AD2R

N-[(4-Pyridyl)methyl]cyclopropanamine

CAS: 193153-60-5

N-[(4-Pyridyl)methyl]cyclopropanamine

Purity: ≥95%

Molecular weight: 148.20g/mol

Ref: 54-OR470955

Cyclopropyl-pyridin-4-ylmethyl-amine

CAS: 193153-60-5

Formula: C₉H₁₂N₂

Purity: 95.0%

Molecular weight: 148.209

Ref: 10-F058179

Cyclopropyl-pyridin-4-ylmethyl-amine

CAS: 193153-60-5

Versatile small molecule scaffold

Formula: C₉H₁₂N₂

Purity: Min. 95%

Molecular weight: 148.2 g/mol

Ref: 3D-THA15360