CAS 19316-85-9
:5'-AZIDO-5'-DEOXYTHYMIDINE
Description:
5'-Azido-5'-deoxythymidine, commonly referred to as AZT or zidovudine, is a nucleoside analog with significant antiviral properties, particularly against HIV. It is characterized by the presence of an azido group (-N3) at the 5' position of the deoxythymidine molecule, which replaces the hydroxyl group typically found in natural nucleosides. This modification enhances its ability to inhibit reverse transcriptase, an enzyme critical for viral replication. AZT is a white to off-white crystalline powder that is soluble in water and exhibits a molecular formula that reflects its nucleoside structure. Its mechanism of action involves incorporation into viral DNA, leading to chain termination during DNA synthesis. AZT is used clinically in the treatment of HIV/AIDS and is often part of combination therapy regimens. However, it can have side effects, including bone marrow suppression and gastrointestinal issues. As a result, monitoring and management of these effects are essential during treatment. Overall, 5'-azido-5'-deoxythymidine represents a crucial advancement in antiviral therapy.
Formula:C10H13N5O4
InChI:InChI=1/C10H13N5O4/c1-5-4-15(10(18)13-9(5)17)8-2-6(16)7(19-8)3-12-14-11/h4,6-8,11,16H,2-3H2,1H3/p+1
Synonyms:- 5'-Azido-5'-Deoxy-D-Thymidine
- 1-(2,5-dideoxy-5-triaza-1,2-dien-2-ium-1-ylpentofuranosyl)-5-methylpyrimidine-2,4(1H,3H)-dione
- NSC 254064
- 5'-AZIDO-5'-DEOXYTHYMIDINE
- 1-((2R,4S,5R)-5-(azidoMethyl)-4-hydroxytetrahydrofuran-2-yl)-5-MethylpyriMidine-2,4(1H,3H)-dione
- 5'-AZT
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
5''-Azido-5''-deoxythymidine
CAS:Formula:C10H13N5O4Purity:≥ 95.0%Color and Shape:White to off-white crystalline powderMolecular weight:267.245'-Azido-5'-deoxythymidine
CAS:5'-Azido-5'-deoxythymidine is a nucleoside analog with potential anti-tuberculosis activity and an inhibitor of TMPKmt in Mycobacterium tuberculosis.Formula:C10H13N5O4Purity:99.85%Color and Shape:SolidMolecular weight:267.245'-Azido-5'-deoxythymidine
CAS:5'-Azido-5'-deoxythymidine is a synthetic analogue of thymidine. The compound has been synthesised and fluorescently labelled with ferrocene. 5'-Azido-5'-deoxythymidine is not cytotoxic to cancer cells, but it is shown to be an effective inhibitor of DNA synthesis by binding to the enzyme DNA polymerase. This causes a decrease in the rate of DNA synthesis and thus inhibits cancer cell growth.Formula:C10H13N5O4Purity:Min. 95%Color and Shape:White PowderMolecular weight:267.24 g/mol5'-Azido-5'-deoxythymidine-d3
CAS:Controlled ProductFormula:C10D3H10N5O4Color and Shape:NeatMolecular weight:270.265’-Azido-(5’-deoxy)thymidine
CAS:Controlled ProductFormula:C10H13N5O4Color and Shape:NeatMolecular weight:267.241





